The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(2-(difluoromethoxy)benzyl)-N2-ethyl-N4-(2-(methylamino)-2-oxoethyl)-1H-pyrrole-2,4-dicarboxamide ID: ALA4763165
PubChem CID: 162660045
Max Phase: Preclinical
Molecular Formula: C19H22F2N4O4
Molecular Weight: 408.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)c1cc(C(=O)N(CC(=O)NC)Cc2ccccc2OC(F)F)c[nH]1
Standard InChI: InChI=1S/C19H22F2N4O4/c1-3-23-17(27)14-8-13(9-24-14)18(28)25(11-16(26)22-2)10-12-6-4-5-7-15(12)29-19(20)21/h4-9,19,24H,3,10-11H2,1-2H3,(H,22,26)(H,23,27)
Standard InChI Key: WOWDIQNXODFHPO-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
3.2978 -29.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9550 -29.9681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6212 -29.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3745 -28.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5582 -28.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5183 -29.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9161 -29.1752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1158 -29.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3409 -30.5254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8592 -28.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6740 -28.1496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1581 -27.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8344 -26.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0215 -26.6521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5324 -27.3100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 -26.0888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9990 -28.8994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8108 -28.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1316 -29.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9426 -29.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4304 -29.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1013 -28.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2912 -28.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6431 -30.3973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9663 -31.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4696 -31.7906 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.7779 -31.2433 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.9969 -25.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5771 -28.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
1 6 1 0
6 7 1 0
8 7 1 0
6 9 2 0
4 10 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 1 0
13 14 2 0
13 16 1 0
11 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
19 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
16 28 1 0
8 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.40Molecular Weight (Monoisotopic): 408.1609AlogP: 1.75#Rotatable Bonds: 9Polar Surface Area: 103.53Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.18CX Basic pKa: ┄CX LogP: 1.09CX LogD: 1.09Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.96
References 1. Veerman JJN,Bruseker YB,Damen E,Heijne EH,van Bruggen W,Hekking KFW,Winkel R,Hupp CD,Keefe AD,Liu J,Thomson HA,Zhang Y,Cuozzo JW,McRiner AJ,Mulvihill MJ,van Rijnsbergen P,Zech B,Renzetti LM,Babiss L,Müller G. (2021) Discovery of 2,4-1H-Imidazole Carboxamides as Potent and Selective TAK1 Inhibitors., 12 (4.0): [PMID:33859795 ] [10.1021/acsmedchemlett.0c00547 ]