N4-(2-(difluoromethoxy)benzyl)-N2-ethyl-N4-(2-(methylamino)-2-oxoethyl)-1H-pyrrole-2,4-dicarboxamide

ID: ALA4763165

PubChem CID: 162660045

Max Phase: Preclinical

Molecular Formula: C19H22F2N4O4

Molecular Weight: 408.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCNC(=O)c1cc(C(=O)N(CC(=O)NC)Cc2ccccc2OC(F)F)c[nH]1

Standard InChI:  InChI=1S/C19H22F2N4O4/c1-3-23-17(27)14-8-13(9-24-14)18(28)25(11-16(26)22-2)10-12-6-4-5-7-15(12)29-19(20)21/h4-9,19,24H,3,10-11H2,1-2H3,(H,22,26)(H,23,27)

Standard InChI Key:  WOWDIQNXODFHPO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
    3.2978  -29.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9550  -29.9681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6212  -29.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3745  -28.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5582  -28.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5183  -29.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9161  -29.1752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1158  -29.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3409  -30.5254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8592  -28.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6740  -28.1496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1581  -27.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8344  -26.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0215  -26.6521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5324  -27.3100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3215  -26.0888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9990  -28.8994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8108  -28.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1316  -29.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9426  -29.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4304  -29.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1013  -28.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2912  -28.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6431  -30.3973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9663  -31.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4696  -31.7906    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.7779  -31.2433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.9969  -25.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5771  -28.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  6  9  2  0
  4 10  1  0
 10 11  1  0
 10 15  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 16  1  0
 11 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 16 28  1  0
  8 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763165

    ---

Associated Targets(Human)

TAB1 Tchem TAK1/TAB1 (257 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.40Molecular Weight (Monoisotopic): 408.1609AlogP: 1.75#Rotatable Bonds: 9
Polar Surface Area: 103.53Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.18CX Basic pKa: CX LogP: 1.09CX LogD: 1.09
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.96

References

1. Veerman JJN,Bruseker YB,Damen E,Heijne EH,van Bruggen W,Hekking KFW,Winkel R,Hupp CD,Keefe AD,Liu J,Thomson HA,Zhang Y,Cuozzo JW,McRiner AJ,Mulvihill MJ,van Rijnsbergen P,Zech B,Renzetti LM,Babiss L,Müller G.  (2021)  Discovery of 2,4-1H-Imidazole Carboxamides as Potent and Selective TAK1 Inhibitors.,  12  (4.0): [PMID:33859795] [10.1021/acsmedchemlett.0c00547]

Source