The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3-(5-((5-chloro-4-(trifluoromethyl)pyridin-2-ylamino)methyl)thiazol-2-ylamino)piperidine-1-carbonyl)phenyl)acrylamide ID: ALA4763202
PubChem CID: 146646558
Max Phase: Preclinical
Molecular Formula: C25H24ClF3N6O2S
Molecular Weight: 565.02
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccc(C(=O)N2CCCC(Nc3ncc(CNc4cc(C(F)(F)F)c(Cl)cn4)s3)C2)cc1
Standard InChI: InChI=1S/C25H24ClF3N6O2S/c1-2-22(36)33-16-7-5-15(6-8-16)23(37)35-9-3-4-17(14-35)34-24-32-12-18(38-24)11-30-21-10-19(25(27,28)29)20(26)13-31-21/h2,5-8,10,12-13,17H,1,3-4,9,11,14H2,(H,30,31)(H,32,34)(H,33,36)
Standard InChI Key: ALIURTYZQYAYDF-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
22.9495 -8.0017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6557 -7.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4011 -7.9184 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.9456 -7.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5343 -6.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7357 -6.7759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7564 -7.3880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0902 -8.1350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9030 -8.2193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2403 -7.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2421 -6.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5370 -6.3737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8284 -6.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8295 -7.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5392 -8.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5370 -5.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2447 -5.1479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8293 -5.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8312 -4.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1243 -3.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4156 -4.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4183 -5.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1257 -5.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7074 -3.9233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7063 -3.1061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9981 -2.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4135 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9970 -1.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2320 -8.9664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0440 -9.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5243 -8.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1868 -7.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3757 -7.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3372 -8.4719 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.6639 -6.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4770 -7.0578 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.0817 -6.3931 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.6595 -6.1578 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 2 0
7 8 1 0
4 7 1 0
8 9 1 0
10 1 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
12 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
9 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 9 1 0
31 34 1 0
32 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.02Molecular Weight (Monoisotopic): 564.1322AlogP: 5.66#Rotatable Bonds: 8Polar Surface Area: 99.25Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.95CX Basic pKa: 4.35CX LogP: 4.54CX LogD: 4.54Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.83
References 1. (2020) Inhibitors of cyclin-dependent kinases,