The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-hydroxyamoorastatin ID: ALA4763211
PubChem CID: 162660483
Max Phase: Preclinical
Molecular Formula: C28H36O10
Molecular Weight: 532.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H]1C[C@H](O)[C@@]23COC(O)[C@]1(C)[C@@H]2C[C@@H](O)[C@]1(C)[C@@H]3C(=O)C(O)[C@@]2(C)[C@H](c3ccoc3)C[C@H]3O[C@@]312
Standard InChI: InChI=1S/C28H36O10/c1-12(29)37-18-9-17(31)27-11-36-23(34)24(18,2)15(27)8-16(30)26(4)21(27)20(32)22(33)25(3)14(13-5-6-35-10-13)7-19-28(25,26)38-19/h5-6,10,14-19,21-23,30-31,33-34H,7-9,11H2,1-4H3/t14-,15-,16+,17-,18+,19+,21-,22?,23?,24+,25+,26+,27+,28+/m0/s1
Standard InChI Key: PUNWVWPDKCBXSA-GVRQUNDGSA-N
Molfile:
RDKit 2D
41 47 0 0 0 0 0 0 0 0999 V2000
10.2445 -12.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2445 -13.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9500 -13.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9500 -12.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6554 -12.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6543 -13.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3549 -13.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0634 -13.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3613 -12.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0628 -12.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0799 -11.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3651 -11.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7814 -11.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0326 -11.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5579 -11.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8159 -10.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5972 -10.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6066 -9.3704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8293 -9.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3426 -9.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5445 -12.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7731 -12.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9336 -13.0593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6622 -11.0156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9500 -11.4234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5363 -13.8829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8304 -13.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1222 -13.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8286 -12.6545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7705 -13.8898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0546 -11.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3547 -13.0641 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.7775 -10.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3640 -14.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8313 -13.3638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7872 -12.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3509 -14.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8601 -14.2565 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.9019 -15.1299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6805 -13.3302 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0905 -10.2142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 22 1 0
13 11 1 0
11 12 1 0
13 22 1 0
21 14 1 0
14 15 1 0
15 13 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 16 1 0
15 16 1 6
22 21 1 0
22 23 1 1
21 23 1 0
12 24 2 0
4 25 1 6
2 26 1 6
26 27 1 0
27 28 1 0
27 29 2 0
8 30 1 6
10 31 1 1
9 32 1 6
13 33 1 6
3 34 1 0
34 35 1 0
35 36 1 0
5 36 1 1
3 37 1 6
6 38 1 6
34 39 1 0
21 40 1 6
11 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.59Molecular Weight (Monoisotopic): 532.2308AlogP: 0.90#Rotatable Bonds: 2Polar Surface Area: 159.19Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.84CX Basic pKa: ┄CX LogP: -0.37CX LogD: -0.37Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: 3.63
References 1. Ren Y,Kinghorn AD. (2020) Development of Potential Antitumor Agents from the Scaffolds of Plant-Derived Terpenoid Lactones., 63 (24.0): [PMID:33289552 ] [10.1021/acs.jmedchem.0c01449 ]