The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,Z)-3-bromo-N-(1-bromo-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-3-oxo-1-phenylprop-1-en-2-yl)benzamide ID: ALA4763228
PubChem CID: 162660587
Max Phase: Preclinical
Molecular Formula: C25H22Br2N2O3
Molecular Weight: 558.27
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H](CO)Cc1ccccc1)/C(NC(=O)c1cccc(Br)c1)=C(/Br)c1ccccc1
Standard InChI: InChI=1S/C25H22Br2N2O3/c26-20-13-7-12-19(15-20)24(31)29-23(22(27)18-10-5-2-6-11-18)25(32)28-21(16-30)14-17-8-3-1-4-9-17/h1-13,15,21,30H,14,16H2,(H,28,32)(H,29,31)/b23-22-/t21-/m0/s1
Standard InChI Key: RYJXNQUPJBBFFM-MUBPVYAGSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
14.6502 -24.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6491 -25.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3571 -25.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0668 -25.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0640 -24.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3554 -24.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3569 -26.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6491 -27.1143 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
16.0646 -27.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0644 -27.9318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7724 -26.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4800 -27.1150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7726 -25.8890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1878 -26.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8954 -27.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1880 -25.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8958 -25.4809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8952 -27.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7720 -28.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7718 -29.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4798 -27.9322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0649 -29.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0644 -30.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7725 -30.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4827 -30.3772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4797 -29.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1878 -28.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1872 -29.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8954 -29.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6055 -29.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6026 -28.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3564 -30.7885 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
9 11 1 0
11 12 1 0
11 13 2 0
14 12 1 6
14 15 1 0
14 16 1 0
16 17 1 0
15 18 1 0
10 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
18 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 18 1 0
23 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.27Molecular Weight (Monoisotopic): 555.9997AlogP: 4.66#Rotatable Bonds: 8Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.78CX Basic pKa: ┄CX LogP: 4.54CX LogD: 4.54Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -0.56
References 1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J. (2021) Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents., 29 [PMID:33285406 ] [10.1016/j.bmc.2020.115892 ]