(4aR,6R,6aR,9S,11S,11bS,12R,14R)-11b-(acetoxymethyl)-6,11-dihydroxy-4,4-dimethyl-8-methylene-7-oxotetradecahydro-6a,9-methanocyclohepta[a]naphthalen-12-yl-3-chlorobenzoate

ID: ALA4763280

PubChem CID: 162659143

Max Phase: Preclinical

Molecular Formula: C29H35ClO7

Molecular Weight: 531.05

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)c1cccc(Cl)c1

Standard InChI:  InChI=1S/C29H35ClO7/c1-15-19-12-20(32)23-28(14-36-16(2)31)10-6-9-27(3,4)21(28)13-22(33)29(23,24(15)34)25(19)37-26(35)17-7-5-8-18(30)11-17/h5,7-8,11,19-23,25,32-33H,1,6,9-10,12-14H2,2-4H3/t19-,20+,21-,22-,23+,25-,28+,29-/m1/s1

Standard InChI Key:  LZKQCGBQUVLSSC-PGSPYRNJSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   28.0734  -30.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6689  -29.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2600  -30.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3788  -28.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8027  -28.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3788  -29.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0887  -27.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5167  -27.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6689  -27.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5167  -27.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0887  -29.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0887  -27.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8027  -29.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9549  -29.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8027  -26.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9549  -28.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3788  -27.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0887  -28.7668    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.3788  -30.0008    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.0120  -27.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5951  -28.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6987  -26.3151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.6711  -27.1200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6711  -26.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9634  -25.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3788  -25.8942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3818  -26.7018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9863  -29.1293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.2245  -28.3498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5114  -29.5823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6270  -29.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2163  -29.7581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8230  -27.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4417  -29.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8444  -29.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6584  -29.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0674  -29.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6565  -28.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8439  -28.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0657  -30.4706    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  7  1  0
  6  4  1  0
  7  4  1  0
  2  6  1  0
  8  5  1  0
  9  4  1  0
 10 15  1  0
 11  6  1  0
 12  7  1  0
 13  5  1  0
 14 16  1  0
 15 12  1  0
 16  9  1  0
  4 17  1  6
  7 18  1  1
  6 19  1  1
 14  2  1  0
 13 11  1  0
 10  8  1  0
 10 20  1  0
  5 21  1  1
 21 20  1  0
 10 22  1  1
 17 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 12 27  1  1
 21 28  2  0
  8 29  1  1
 13 30  1  6
 29 31  1  0
 31 32  2  0
 31 34  1  0
 20 33  2  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 36 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763280

    ---

Associated Targets(Human)

ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TE-1 (337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.05Molecular Weight (Monoisotopic): 530.2071AlogP: 4.13#Rotatable Bonds: 4
Polar Surface Area: 110.13Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.03CX LogD: 4.03
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: 2.34

References

1. Huo JF,Hu TX,Dong YL,Zhao JZ,Liu XJ,Li LL,Zhang XY,Li YF,Liu HM,Ke Y,Wang C.  (2020)  Synthesis and in vitro and in vivo biological evaluation of novel derivatives of flexicaulin A as antiproliferative agents.,  208  [PMID:32883640] [10.1016/j.ejmech.2020.112789]

Source