N-ethyl-dregamine

ID: ALA4763349

PubChem CID: 162659924

Max Phase: Preclinical

Molecular Formula: C23H30N2O3

Molecular Weight: 382.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@H]1CN(C)[C@H]2Cc3c(n(CC)c4ccccc34)C(=O)C[C@H]1C2C(=O)OC

Standard InChI:  InChI=1S/C23H30N2O3/c1-5-14-13-24(3)19-11-17-15-9-7-8-10-18(15)25(6-2)22(17)20(26)12-16(14)21(19)23(27)28-4/h7-10,14,16,19,21H,5-6,11-13H2,1-4H3/t14-,16+,19-,21?/m0/s1

Standard InChI Key:  YIEYHNJRSCNXSO-SXRGTPKPSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   22.9491   -2.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9479   -3.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6608   -3.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6590   -2.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3725   -2.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3728   -3.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1610   -3.7987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1626   -2.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6519   -3.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4914   -1.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8049   -2.2813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4699   -3.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9549   -3.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7772   -3.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1121   -2.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6248   -2.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0505   -3.7482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2098   -1.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2612   -4.2819    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.3900   -0.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1847   -0.5412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1771    0.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7665    0.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3194   -1.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8082   -0.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3122   -0.7937    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.9302   -2.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4146   -3.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4144   -4.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8632   -5.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 10  1  0
  9 12  1  0
 11 24  1  0
 24 10  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 12 17  2  0
 11 18  1  0
 14 19  1  6
 25 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 14 25  1  0
 25 24  1  0
 24 26  1  6
 15 27  1  6
 27 28  1  0
  7 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763349

    ---

Associated Targets(Human)

COLO 205 (50209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
COLO 320 (353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.50Molecular Weight (Monoisotopic): 382.2256AlogP: 3.54#Rotatable Bonds: 3
Polar Surface Area: 51.54Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.58CX LogP: 3.24CX LogD: 2.84
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: 0.75

References

1. Cardoso DSP,Kincses A,Nové M,Spengler G,Mulhovo S,Aires-de-Sousa J,Dos Santos DJVA,Ferreira MU.  (2021)  Alkylated monoterpene indole alkaloid derivatives as potent P-glycoprotein inhibitors in resistant cancer cells.,  210  [PMID:33189435] [10.1016/j.ejmech.2020.112985]

Source