1-(4-bromophenyl)-6-(2-propoxyphenyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4763502

PubChem CID: 162659513

Max Phase: Preclinical

Molecular Formula: C20H17BrN4O2

Molecular Weight: 425.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCOc1ccccc1-c1nc2c(cnn2-c2ccc(Br)cc2)c(=O)[nH]1

Standard InChI:  InChI=1S/C20H17BrN4O2/c1-2-11-27-17-6-4-3-5-15(17)18-23-19-16(20(26)24-18)12-22-25(19)14-9-7-13(21)8-10-14/h3-10,12H,2,11H2,1H3,(H,23,24,26)

Standard InChI Key:  ITHUDKYWNWMVEA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   34.6895  -14.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4034  -13.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1134  -14.1224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1134  -14.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4018  -15.3544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6895  -14.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9041  -15.2035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4201  -14.5363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9042  -13.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6891  -16.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2726  -16.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0616  -17.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2627  -17.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6816  -17.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8897  -16.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0476  -18.3904    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   36.8270  -15.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5408  -14.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2549  -15.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2549  -16.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5434  -16.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8270  -16.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5408  -14.1183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2586  -13.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2586  -12.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9721  -12.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4034  -12.8859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  1  9  1  0
 10  7  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 13 16  1  0
 17  4  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
  2 27  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4763502

    ---

Associated Targets(Human)

PDE5A Tclin Phosphodiesterase 5A (5113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Corpus cavernosum (27 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.29Molecular Weight (Monoisotopic): 424.0535AlogP: 4.33#Rotatable Bonds: 5
Polar Surface Area: 72.80Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.88CX Basic pKa: CX LogP: 4.29CX LogD: 4.28
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.52Np Likeness Score: -1.64

References

1. Shaaban MA,Elshaier YAMM,Hammad AH,Farag NA,Hassan Haredy H,AbdEl-Ghany AA,Mohamed KO.  (2020)  Design and synthesis of pyrazolo[3,4-d]pyrimidinone derivatives: Discovery of selective phosphodiesterase-5 inhibitors.,  30  (16): [PMID:32631538] [10.1016/j.bmcl.2020.127337]

Source