The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(3-(dimethylamino)phenoxy)-3-(2-(4-fluoropiperidin-1-yl)-2-oxoethyl)-4-oxo-3,4-dihydroquinazolin-7-yl)-2-((4-(trifluoromethyl)benzyl)oxy)acetamide ID: ALA4763527
PubChem CID: 162662060
Max Phase: Preclinical
Molecular Formula: C33H33F4N5O5
Molecular Weight: 655.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc(Oc2cc3c(=O)n(CC(=O)N4CCC(F)CC4)cnc3cc2NC(=O)COCc2ccc(C(F)(F)F)cc2)c1
Standard InChI: InChI=1S/C33H33F4N5O5/c1-40(2)24-4-3-5-25(14-24)47-29-15-26-27(38-20-42(32(26)45)17-31(44)41-12-10-23(34)11-13-41)16-28(29)39-30(43)19-46-18-21-6-8-22(9-7-21)33(35,36)37/h3-9,14-16,20,23H,10-13,17-19H2,1-2H3,(H,39,43)
Standard InChI Key: BCUWSFGSHPDVGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 51 0 0 0 0 0 0 0 0999 V2000
9.0916 -22.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0905 -23.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8051 -23.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8032 -21.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5185 -22.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5218 -23.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2408 -23.4752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9610 -23.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9576 -22.2254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2340 -21.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2295 -20.9848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6705 -21.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3724 -23.4720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3771 -21.8220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6602 -23.0563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3773 -20.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3861 -22.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0912 -20.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0918 -19.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3772 -19.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6604 -19.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6633 -20.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6640 -22.2315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9439 -23.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3886 -23.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2317 -23.0495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5154 -23.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8032 -23.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8061 -22.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0947 -21.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3776 -22.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3762 -23.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0883 -23.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6626 -21.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7231 -20.9607 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9631 -22.3193 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0398 -21.3326 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.9448 -19.3585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0990 -21.8063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9421 -18.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2319 -19.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8121 -22.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5231 -21.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5248 -20.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8093 -20.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0922 -20.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2418 -20.5741 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
9 12 1 0
2 13 1 0
1 14 1 0
13 15 1 0
14 16 1 0
12 17 1 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
15 23 2 0
15 24 1 0
17 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
34 35 1 0
34 36 1 0
34 37 1 0
31 34 1 0
21 38 1 0
17 39 1 0
38 40 1 0
38 41 1 0
39 42 1 0
39 46 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
44 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 655.65Molecular Weight (Monoisotopic): 655.2418AlogP: 5.39#Rotatable Bonds: 10Polar Surface Area: 106.00Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.14CX Basic pKa: 4.39CX LogP: 3.55CX LogD: 3.55Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.23Np Likeness Score: -1.59
References 1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G. (2020) Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy., 207 [PMID:32920426 ] [10.1016/j.ejmech.2020.112723 ]