2-(benzo[d]thiazol-2-yl)-N-(1,2,3,5,6,7-hexahydros-indacen-4-ylcarbamoyl)ethenesulfonamide

ID: ALA4763529

PubChem CID: 137537396

Max Phase: Preclinical

Molecular Formula: C22H21N3O3S2

Molecular Weight: 439.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)/C=C/c1nc2ccccc2s1

Standard InChI:  InChI=1S/C22H21N3O3S2/c26-22(24-21-16-7-3-5-14(16)13-15-6-4-8-17(15)21)25-30(27,28)12-11-20-23-18-9-1-2-10-19(18)29-20/h1-2,9-13H,3-8H2,(H2,24,25,26)/b12-11+

Standard InChI Key:  ZGHYQRRPXRUMCT-VAWYXSNFSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   30.3434   -2.1214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7602   -2.8354    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.1687   -2.1189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6055   -2.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0286   -2.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6066   -2.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3140   -1.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1440   -0.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3313   -0.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9977   -1.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0314   -2.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3228   -3.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4948   -4.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3098   -4.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6429   -3.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8939   -3.2467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1818   -2.8385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4743   -3.2475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1813   -2.0131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0506   -3.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3364   -2.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6270   -3.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8723   -2.9245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5402   -4.0723    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.7380   -4.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3269   -3.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5092   -3.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1015   -4.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5176   -4.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3340   -4.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  6  4  2  0
  4 12  1  0
 11  5  1  0
  5  7  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
  4 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18  2  1  0
  2 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 26  1  0
 25 24  1  0
 24 22  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763529

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.56Molecular Weight (Monoisotopic): 439.1024AlogP: 4.40#Rotatable Bonds: 4
Polar Surface Area: 88.16Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.64CX Basic pKa: 1.92CX LogP: 4.96CX LogD: 4.14
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -1.20

References

1. Agarwal S,Pethani JP,Shah HA,Vyas V,Sasane S,Bhavsar H,Bandyopadhyay D,Giri P,Viswanathan K,Jain MR,Sharma R.  (2020)  Identification of a novel orally bioavailable NLRP3 inflammasome inhibitor.,  30  (21.0): [PMID:32980515] [10.1016/j.bmcl.2020.127571]

Source