The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methoxy-N-(4-methoxy-7-morpholin-4-yl-benzo[d]thiazol-2-yl)piperidine-1-carboxamide ID: ALA4763600
PubChem CID: 91506978
Max Phase: Preclinical
Molecular Formula: C19H26N4O4S
Molecular Weight: 406.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2CCOCC2)c2sc(NC(=O)N3CCC(OC)CC3)nc12
Standard InChI: InChI=1S/C19H26N4O4S/c1-25-13-5-7-23(8-6-13)19(24)21-18-20-16-15(26-2)4-3-14(17(16)28-18)22-9-11-27-12-10-22/h3-4,13H,5-12H2,1-2H3,(H,20,21,24)
Standard InChI Key: AJALRWKUIRQDLA-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
19.7474 -3.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7462 -4.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4543 -5.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4525 -3.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1611 -3.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1614 -4.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9443 -5.0565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4280 -4.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9439 -3.7246 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.4496 -2.7569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1572 -2.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1563 -1.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4491 -1.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7411 -1.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7404 -2.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4522 -6.0270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7435 -6.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2444 -4.3928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6552 -3.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4724 -3.6889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2487 -2.9774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6592 -2.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2562 -1.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4387 -1.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0258 -2.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4303 -2.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0314 -0.8387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4438 -0.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
4 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
3 16 1 0
16 17 1 0
8 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.51Molecular Weight (Monoisotopic): 406.1675AlogP: 2.78#Rotatable Bonds: 4Polar Surface Area: 76.16Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.96CX Basic pKa: 0.13CX LogP: 1.84CX LogD: 1.74Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.84Np Likeness Score: -1.79
References 1. Renk DR,Skraban M,Bier D,Schulze A,Wabbals E,Wedekind F,Neumaier F,Neumaier B,Holschbach M. (2021) Design, synthesis and biological evaluation of Tozadenant analogues as adenosine A receptor ligands., 214 [PMID:33548636 ] [10.1016/j.ejmech.2021.113214 ]