(S)-1-(6-(6-(2-Fluoro-6-methoxyphenyl)-1H-pyrazolo[4,3-c]pyridin-1-yl)pyridin-2-yl)-N,N-dimethylpyrrolidin-3-amine

ID: ALA4763655

PubChem CID: 162661880

Max Phase: Preclinical

Molecular Formula: C24H25FN6O

Molecular Weight: 432.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(F)c1-c1cc2c(cn1)cnn2-c1cccc(N2CC[C@H](N(C)C)C2)n1

Standard InChI:  InChI=1S/C24H25FN6O/c1-29(2)17-10-11-30(15-17)22-8-5-9-23(28-22)31-20-12-19(26-13-16(20)14-27-31)24-18(25)6-4-7-21(24)32-3/h4-9,12-14,17H,10-11,15H2,1-3H3/t17-/m0/s1

Standard InChI Key:  CORINSIPRISQBV-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    4.5798   -5.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5787   -6.1312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2867   -6.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2849   -4.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9935   -5.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9983   -6.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7784   -6.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2557   -5.7100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7706   -5.0507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0186   -4.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8720   -4.9033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8752   -4.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1682   -3.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4597   -4.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5838   -3.6780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1700   -5.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4590   -4.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5854   -2.8608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1752   -6.1289    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8187   -4.1022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0668   -3.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5161   -2.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7143   -2.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4699   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8652   -3.1501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4698   -3.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1753   -3.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0011   -2.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1879   -2.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9236   -3.6092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0134   -4.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5822   -3.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
  1 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 17  1  0
 16 11  1  0
 12 15  1  0
 16 17  2  0
 15 18  1  0
 16 19  1  0
 10 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 10  1  0
 21 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
 27 30  1  6
 30 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763655

    ---

Associated Targets(Human)

MAP4K1 Tchem Mitogen-activated protein kinase kinase kinase kinase 1 (947 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.50Molecular Weight (Monoisotopic): 432.2074AlogP: 3.77#Rotatable Bonds: 5
Polar Surface Area: 59.31Molecular Species: BASEHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.11CX LogP: 3.92CX LogD: 2.21
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.50

References

1. Yu EC,Methot JL,Fradera X,Lesburg CA,Lacey BM,Siliphaivanh P,Liu P,Smith DM,Xu Z,Piesvaux JA,Kawamura S,Xu H,Miller JR,Bittinger M,Pasternak A.  (2021)  Identification of Potent Reverse Indazole Inhibitors for HPK1.,  12  (3.0): [PMID:33738073] [10.1021/acsmedchemlett.0c00672]

Source