The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4763675
Cas Number: 141196-69-2
PubChem CID: 10906957
Product Number: O329506, Order Now?
Max Phase: Preclinical
Molecular Formula: C28H24N4O4
Molecular Weight: 480.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4=O
Standard InChI: InChI=1S/C28H24N4O4/c1-28-25(35-3)15(29-2)12-18(36-28)31-16-10-6-4-8-13(16)19-21-22(27(34)30-26(21)33)20-14-9-5-7-11-17(14)32(28)24(20)23(19)31/h4-11,15,18,25,29H,12H2,1-3H3,(H,30,33,34)/t15-,18-,25-,28+/m1/s1
Standard InChI Key: POTTVLREWUNNRO-UGZRAAABSA-N
Molfile:
RDKit 2D
37 44 0 0 0 0 0 0 0 0999 V2000
14.5118 -7.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2561 -6.7568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1908 -6.7444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8130 -6.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6379 -6.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2296 -6.9589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9309 -7.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0422 -5.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3922 -5.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6174 -4.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8006 -4.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5012 -6.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9414 -6.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5036 -8.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8549 -5.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5795 -5.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9309 -8.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8689 -3.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2007 -3.4321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2131 -8.6089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5366 -3.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6568 -3.6589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7157 -7.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2049 -9.4298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7941 -8.5965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7505 -6.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6922 -6.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9031 -5.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5148 -5.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9267 -9.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0804 -8.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3687 -6.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2532 -5.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0657 -6.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1647 -5.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7311 -7.5983 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.7561 -3.6905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 7 1 0
4 2 1 0
5 4 1 0
6 1 1 0
7 6 1 0
8 5 2 0
9 4 2 0
10 11 2 0
11 9 1 0
12 2 1 0
13 3 1 0
14 1 1 0
15 13 2 0
16 12 1 0
17 20 1 0
18 10 1 0
19 21 1 0
20 14 1 0
21 11 1 0
22 18 2 0
1 23 1 6
20 24 1 1
14 25 1 1
26 12 2 0
27 13 1 0
28 16 2 0
29 15 1 0
30 24 1 0
31 25 1 0
32 27 2 0
33 32 1 0
34 26 1 0
35 34 2 0
7 36 1 6
17 7 1 0
16 9 1 0
3 5 1 0
15 8 1 0
35 28 1 0
10 8 1 0
19 18 1 0
29 33 2 0
21 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.52Molecular Weight (Monoisotopic): 480.1798AlogP: 3.99#Rotatable Bonds: 2Polar Surface Area: 86.52Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.02CX Basic pKa: 9.57CX LogP: 2.33CX LogD: 1.75Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: 1.08
References 1. Wang J,Jin W,Zhou X,Li J,Xu C,Ma Z,Wang J,Qin L,Zhou B,Ding W,Gao T,Yao H,Chen Z. (2020) Identification, Structure-Activity Relationships of Marine-Derived Indolocarbazoles, and a Dual PKCθ/δ Inhibitor with Potent Antipancreatic Cancer Efficacy., 63 (21.0): [PMID:33100009 ] [10.1021/acs.jmedchem.0c01271 ] 2. Wang J,Jin W,Zhou X,Li J,Xu C,Ma Z,Wang J,Qin L,Zhou B,Ding W,Gao T,Yao H,Chen Z. (2020) Identification, Structure-Activity Relationships of Marine-Derived Indolocarbazoles, and a Dual PKCθ/δ Inhibitor with Potent Antipancreatic Cancer Efficacy., 63 (21.0): [PMID:33100009 ] [10.1021/acs.jmedchem.0c01271 ]