The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-[(1S,2S)-2-hydroxy-2-methyl-cyclopentyl]-2-[(1-thiazol-2-ylsulfonyl-4-piperidyl)amino]pyrido[2,3-d]pyrimidin-7-one ID: ALA4763871
PubChem CID: 134253079
Max Phase: Preclinical
Molecular Formula: C21H26N6O4S2
Molecular Weight: 490.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]1(O)CCC[C@@H]1n1c(=O)ccc2cnc(NC3CCN(S(=O)(=O)c4nccs4)CC3)nc21
Standard InChI: InChI=1S/C21H26N6O4S2/c1-21(29)8-2-3-16(21)27-17(28)5-4-14-13-23-19(25-18(14)27)24-15-6-10-26(11-7-15)33(30,31)20-22-9-12-32-20/h4-5,9,12-13,15-16,29H,2-3,6-8,10-11H2,1H3,(H,23,24,25)/t16-,21-/m0/s1
Standard InChI Key: OFUSTOXZRPWIMF-KKSFZXQISA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
20.8714 -6.0546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2841 -6.7645 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.6925 -6.0522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8239 -7.1813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8227 -8.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5308 -8.4098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5290 -6.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2376 -7.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2364 -8.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9465 -8.4143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6623 -8.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6635 -7.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9489 -6.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3689 -8.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9476 -9.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2852 -9.7115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5355 -10.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3527 -10.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6073 -9.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3852 -9.4648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1848 -10.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1147 -8.4089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4073 -7.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4073 -7.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7040 -6.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9936 -7.1784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9910 -7.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6988 -8.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5782 -7.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8364 -6.8450 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.2909 -7.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6983 -8.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4955 -7.9871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
11 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
15 10 1 6
19 20 1 0
19 21 1 6
5 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 2 1 0
2 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.61Molecular Weight (Monoisotopic): 490.1457AlogP: 1.99#Rotatable Bonds: 5Polar Surface Area: 130.31Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.68CX LogP: 1.05CX LogD: 1.05Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -0.90