2-((4-(4-carbamoyl-N-(carboxymethyl)phenylsulfonamido)naphthalen-1-yl)oxy)-2-phenylacetic acid

ID: ALA4763899

PubChem CID: 162661277

Max Phase: Preclinical

Molecular Formula: C27H22N2O8S

Molecular Weight: 534.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccc(S(=O)(=O)N(CC(=O)O)c2ccc(OC(C(=O)O)c3ccccc3)c3ccccc23)cc1

Standard InChI:  InChI=1S/C27H22N2O8S/c28-26(32)18-10-12-19(13-11-18)38(35,36)29(16-24(30)31)22-14-15-23(21-9-5-4-8-20(21)22)37-25(27(33)34)17-6-2-1-3-7-17/h1-15,25H,16H2,(H2,28,32)(H,30,31)(H,33,34)

Standard InChI Key:  IVXOFEZTBIIYEL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    5.0682   -6.7398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4810   -6.0340    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.6634   -6.0295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0804   -7.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0793   -8.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7873   -8.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7855   -7.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4941   -7.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4949   -8.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2034   -8.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9117   -8.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9070   -7.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1979   -7.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1935   -6.4415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8991   -6.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6089   -6.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3145   -6.0216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6133   -7.2511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2051   -9.7121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9137  -10.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9154  -10.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6205   -9.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2085  -11.3465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6239  -11.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3261  -10.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0325   -9.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0312   -8.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3177   -8.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6142   -8.8971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4793   -5.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1852   -4.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1839   -4.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4771   -3.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7702   -4.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7750   -4.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4742   -2.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1805   -2.3666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7651   -2.3713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 22 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 22  1  0
 14  2  1  0
  2 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 36 37  1  0
 36 38  2  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763899

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.55Molecular Weight (Monoisotopic): 534.1097AlogP: 3.42#Rotatable Bonds: 10
Polar Surface Area: 164.30Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.86CX Basic pKa: CX LogP: 3.26CX LogD: -3.63
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -0.99

References

1. Lu MC,Shao HL,Liu T,You QD,Jiang ZY.  (2020)  Discovery of 2-oxy-2-phenylacetic acid substituted naphthalene sulfonamide derivatives as potent KEAP1-NRF2 protein-protein interaction inhibitors for inflammatory conditions.,  207  [PMID:32866756] [10.1016/j.ejmech.2020.112734]

Source