The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(4-carbamoyl-N-(carboxymethyl)phenylsulfonamido)naphthalen-1-yl)oxy)-2-phenylacetic acid ID: ALA4763899
PubChem CID: 162661277
Max Phase: Preclinical
Molecular Formula: C27H22N2O8S
Molecular Weight: 534.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccc(S(=O)(=O)N(CC(=O)O)c2ccc(OC(C(=O)O)c3ccccc3)c3ccccc23)cc1
Standard InChI: InChI=1S/C27H22N2O8S/c28-26(32)18-10-12-19(13-11-18)38(35,36)29(16-24(30)31)22-14-15-23(21-9-5-4-8-20(21)22)37-25(27(33)34)17-6-2-1-3-7-17/h1-15,25H,16H2,(H2,28,32)(H,30,31)(H,33,34)
Standard InChI Key: IVXOFEZTBIIYEL-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
5.0682 -6.7398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4810 -6.0340 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.6634 -6.0295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0804 -7.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0793 -8.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7873 -8.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7855 -7.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4941 -7.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4949 -8.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2034 -8.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9117 -8.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9070 -7.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1979 -7.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1935 -6.4415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8991 -6.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6089 -6.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3145 -6.0216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6133 -7.2511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2051 -9.7121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9137 -10.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9154 -10.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6205 -9.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2085 -11.3465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6239 -11.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3261 -10.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0325 -9.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0312 -8.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3177 -8.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6142 -8.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4793 -5.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1852 -4.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1839 -4.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4771 -3.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7702 -4.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7750 -4.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4742 -2.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1805 -2.3666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7651 -2.3713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
10 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
21 23 2 0
21 24 1 0
22 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 22 1 0
14 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 1 0
36 38 2 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.55Molecular Weight (Monoisotopic): 534.1097AlogP: 3.42#Rotatable Bonds: 10Polar Surface Area: 164.30Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.86CX Basic pKa: ┄CX LogP: 3.26CX LogD: -3.63Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -0.99
References 1. Lu MC,Shao HL,Liu T,You QD,Jiang ZY. (2020) Discovery of 2-oxy-2-phenylacetic acid substituted naphthalene sulfonamide derivatives as potent KEAP1-NRF2 protein-protein interaction inhibitors for inflammatory conditions., 207 [PMID:32866756 ] [10.1016/j.ejmech.2020.112734 ]