N-(6-(3-chlorophenyl)pyridazin-3-yl)-4-(dimethylamino)benzenesulfonamide

ID: ALA4763938

PubChem CID: 162661570

Max Phase: Preclinical

Molecular Formula: C18H17ClN4O2S

Molecular Weight: 388.88

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(S(=O)(=O)Nc2ccc(-c3cccc(Cl)c3)nn2)cc1

Standard InChI:  InChI=1S/C18H17ClN4O2S/c1-23(2)15-6-8-16(9-7-15)26(24,25)22-18-11-10-17(20-21-18)13-4-3-5-14(19)12-13/h3-12H,1-2H3,(H,21,22)

Standard InChI Key:  JFVMDNCXMKAMMN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   31.7012  -10.2438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.2968   -9.5380    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.8878  -10.2412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4682   -9.5504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4671  -10.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1751  -10.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8848  -10.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8819   -9.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1733   -9.1415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7609  -10.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0533  -10.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3457  -10.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3446  -11.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0570  -12.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7616  -11.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6385  -10.3652    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.5881   -9.1355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0035   -9.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7112   -9.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4169   -9.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4142   -8.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7000   -7.9051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9972   -8.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1198   -7.8987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8296   -8.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1157   -7.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  5 10  1  0
 12 16  1  0
  8 17  1  0
 17  2  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763938

    ---

Associated Targets(non-human)

Kmo Kynurenine 3-monooxygenase (34 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.88Molecular Weight (Monoisotopic): 388.0761AlogP: 3.66#Rotatable Bonds: 5
Polar Surface Area: 75.19Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.61CX Basic pKa: 2.36CX LogP: 3.60CX LogD: 2.98
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.72Np Likeness Score: -2.05

References

1. Kimura H,Suda H,Kassai M,Endo M,Deai Y,Yahata M,Miyajima M,Isobe Y.  (2021)  N-(6-phenylpyridazin-3-yl)benzenesulfonamides as highly potent, brain-permeable, and orally active kynurenine monooxygenase inhibitors.,  33  [PMID:33359168] [10.1016/j.bmcl.2020.127753]

Source