3-(benzofuran-2-yl(phenyl)methyl)-1H-indole

ID: ALA4763979

PubChem CID: 162661777

Max Phase: Preclinical

Molecular Formula: C23H17NO

Molecular Weight: 323.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(C(c2cc3ccccc3o2)c2c[nH]c3ccccc23)cc1

Standard InChI:  InChI=1S/C23H17NO/c1-2-8-16(9-3-1)23(19-15-24-20-12-6-5-11-18(19)20)22-14-17-10-4-7-13-21(17)25-22/h1-15,23-24H

Standard InChI Key:  TZSLCNYOCARVNS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
    3.3664   -3.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3653   -4.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0733   -5.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0715   -3.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7801   -3.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7849   -4.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5650   -4.9059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0423   -4.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5572   -3.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8595   -4.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2723   -4.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2639   -3.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5315   -2.2341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9275   -2.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8653   -5.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2774   -6.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0954   -6.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4997   -5.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0853   -4.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2416   -2.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0750   -3.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6815   -3.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4548   -3.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6181   -2.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0104   -2.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763979

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.40Molecular Weight (Monoisotopic): 323.1310AlogP: 6.09#Rotatable Bonds: 3
Polar Surface Area: 28.93Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.59CX LogD: 5.59
Aromatic Rings: 5Heavy Atoms: 25QED Weighted: 0.43Np Likeness Score: -0.15

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source