tert-butyl 4-(2-(3-acrylamidobenzamido)thiazol-5-yl)piperazine-1-carboxylate

ID: ALA4763994

PubChem CID: 145749958

Max Phase: Preclinical

Molecular Formula: C22H27N5O4S

Molecular Weight: 457.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cccc(C(=O)Nc2ncc(N3CCN(C(=O)OC(C)(C)C)CC3)s2)c1

Standard InChI:  InChI=1S/C22H27N5O4S/c1-5-17(28)24-16-8-6-7-15(13-16)19(29)25-20-23-14-18(32-20)26-9-11-27(12-10-26)21(30)31-22(2,3)4/h5-8,13-14H,1,9-12H2,2-4H3,(H,24,28)(H,23,25,29)

Standard InChI Key:  HVAWQHDMHMNOAP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   16.7964   -4.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7953   -5.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5033   -6.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2130   -5.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2101   -4.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5015   -4.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9178   -4.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6271   -4.9682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9148   -3.7451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3332   -4.5570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0787   -4.8849    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.6232   -4.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2119   -3.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4133   -3.7424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4340   -4.3545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7678   -5.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5771   -5.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0585   -4.5247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7247   -3.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9095   -3.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0886   -4.5690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0884   -3.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7960   -3.3430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3806   -3.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3804   -2.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8712   -4.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2036   -5.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3516   -3.9490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0163   -5.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3487   -6.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4967   -4.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8311   -5.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7  9  2  0
  5  7  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 12 15  1  0
  1 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  2  0
 18 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4763994

    ---

Associated Targets(Human)

CDK2 Tchem Cyclin-dependent kinase 2 (9050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK7 Tchem Cyclin-dependent kinase 7 (1512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.56Molecular Weight (Monoisotopic): 457.1784AlogP: 3.58#Rotatable Bonds: 5
Polar Surface Area: 103.87Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.61CX Basic pKa: 0.75CX LogP: 3.42CX LogD: 3.42
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.67Np Likeness Score: -1.62

References

1.  (2020)  Inhibitors of cyclin-dependent kinases, 

Source