The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-(2-(3-acrylamidobenzamido)thiazol-5-yl)piperazine-1-carboxylate ID: ALA4763994
PubChem CID: 145749958
Max Phase: Preclinical
Molecular Formula: C22H27N5O4S
Molecular Weight: 457.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(C(=O)Nc2ncc(N3CCN(C(=O)OC(C)(C)C)CC3)s2)c1
Standard InChI: InChI=1S/C22H27N5O4S/c1-5-17(28)24-16-8-6-7-15(13-16)19(29)25-20-23-14-18(32-20)26-9-11-27(12-10-26)21(30)31-22(2,3)4/h5-8,13-14H,1,9-12H2,2-4H3,(H,24,28)(H,23,25,29)
Standard InChI Key: HVAWQHDMHMNOAP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
16.7964 -4.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7953 -5.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5033 -6.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2130 -5.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2101 -4.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5015 -4.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9178 -4.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6271 -4.9682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9148 -3.7451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3332 -4.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0787 -4.8849 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.6232 -4.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2119 -3.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4133 -3.7424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4340 -4.3545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7678 -5.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5771 -5.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0585 -4.5247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7247 -3.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9095 -3.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0886 -4.5690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0884 -3.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7960 -3.3430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3806 -3.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3804 -2.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8712 -4.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2036 -5.3566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3516 -3.9490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0163 -5.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3487 -6.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4967 -4.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8311 -5.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 9 2 0
5 7 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
12 15 1 0
1 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 2 0
18 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.56Molecular Weight (Monoisotopic): 457.1784AlogP: 3.58#Rotatable Bonds: 5Polar Surface Area: 103.87Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.61CX Basic pKa: 0.75CX LogP: 3.42CX LogD: 3.42Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.67Np Likeness Score: -1.62
References 1. (2020) Inhibitors of cyclin-dependent kinases,