The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-acetamido-3-isopropylbenzyl)-3,5-dimethylphenoxy)acetic acid ID: ALA4764051
PubChem CID: 155286423
Max Phase: Preclinical
Molecular Formula: C22H27NO4
Molecular Weight: 369.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(Cc2c(C)cc(OCC(=O)O)cc2C)cc1C(C)C
Standard InChI: InChI=1S/C22H27NO4/c1-13(2)19-10-17(6-7-21(19)23-16(5)24)11-20-14(3)8-18(9-15(20)4)27-12-22(25)26/h6-10,13H,11-12H2,1-5H3,(H,23,24)(H,25,26)
Standard InChI Key: GZHDROJXCQEXMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
4.0226 -3.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0215 -4.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7295 -4.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4392 -4.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4364 -3.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7277 -3.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3148 -3.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3146 -2.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6072 -3.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3135 -4.8843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3128 -5.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6048 -6.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0202 -6.1106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1425 -3.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8518 -3.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8515 -4.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5599 -4.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2671 -4.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2613 -3.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5524 -3.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9769 -4.8621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6825 -4.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3922 -4.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3990 -5.6717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1005 -4.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1444 -4.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5451 -2.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
7 9 1 0
2 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
5 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
16 26 1 0
20 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 369.46Molecular Weight (Monoisotopic): 369.1940AlogP: 4.44#Rotatable Bonds: 7Polar Surface Area: 75.63Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.91CX Basic pKa: ┄CX LogP: 4.89CX LogD: 1.69Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.76Np Likeness Score: -0.47
References 1. Runfola M,Sestito S,Bellusci L,La Pietra V,D'Amore VM,Kowalik MA,Chiellini G,Gul S,Perra A,Columbano A,Marinelli L,Novellino E,Rapposelli S. (2020) Design, synthesis and biological evaluation of novel TRβ selective agonists sustained by ADME-toxicity analysis., 188 [PMID:31931337 ] [10.1016/j.ejmech.2019.112006 ]