The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4764098
PubChem CID: 129909517
Max Phase: Preclinical
Molecular Formula: C19H22N2O5S2
Molecular Weight: 422.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CS[C@@]12CC3=CC=C[C@H](O)[C@H]3N1C(=O)[C@@]13C[C@@H]4[C@@H]([C@@H](O)[C@@H](C[C@@H]4O)S1)N3C2=O
Standard InChI: InChI=1S/C19H22N2O5S2/c1-27-18-6-8-3-2-4-10(22)13(8)20(18)17(26)19-7-9-11(23)5-12(28-19)15(24)14(9)21(19)16(18)25/h2-4,9-15,22-24H,5-7H2,1H3/t9-,10-,11-,12+,13-,14-,15-,18+,19+/m0/s1
Standard InChI Key: GYXDEGFLWPXLBO-DXXLCSEDSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
24.2996 -4.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2996 -3.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5824 -4.4827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5820 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7927 -3.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3589 -2.8581 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.5737 -2.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2965 -2.4154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2960 -5.7204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8003 -4.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3059 -4.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4865 -4.1689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1548 -4.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6450 -5.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4710 -5.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9638 -6.1702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2084 -5.4583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.0083 -3.6575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0053 -4.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7881 -4.7386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7929 -3.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2716 -4.0720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0812 -3.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4186 -3.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9442 -2.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1281 -2.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3746 -2.6861 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.4792 -4.8695 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.6445 -1.9908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7184 -4.0614 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.5586 -4.6651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1625 -1.7578 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 1 1 0
1 19 1 0
18 2 1 0
3 4 1 0
4 5 1 0
5 11 1 0
10 3 1 0
4 6 1 6
6 7 1 0
2 8 2 0
1 9 2 0
10 11 1 0
10 15 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 1
10 17 1 1
18 19 1 0
19 20 1 0
20 22 1 0
21 18 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 27 1 1
22 28 1 1
26 29 1 1
19 30 1 6
25 30 1 0
23 31 1 6
25 32 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.53Molecular Weight (Monoisotopic): 422.0970AlogP: -0.33#Rotatable Bonds: 1Polar Surface Area: 101.31Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.70CX Basic pKa: ┄CX LogP: -0.57CX LogD: -0.57Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: 2.82
References 1. Zhu M,Zhang X,Huang X,Wang H,Anjum K,Gu Q,Zhu T,Zhang G,Li D. (2020) Irregularly Bridged Epipolythiodioxopiperazines and Related Analogues: Sources, Structures, and Biological Activities., 83 (6): [PMID:32543845 ] [10.1021/acs.jnatprod.9b01283 ]