NA

ID: ALA4764098

PubChem CID: 129909517

Max Phase: Preclinical

Molecular Formula: C19H22N2O5S2

Molecular Weight: 422.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS[C@@]12CC3=CC=C[C@H](O)[C@H]3N1C(=O)[C@@]13C[C@@H]4[C@@H]([C@@H](O)[C@@H](C[C@@H]4O)S1)N3C2=O

Standard InChI:  InChI=1S/C19H22N2O5S2/c1-27-18-6-8-3-2-4-10(22)13(8)20(18)17(26)19-7-9-11(23)5-12(28-19)15(24)14(9)21(19)16(18)25/h2-4,9-15,22-24H,5-7H2,1H3/t9-,10-,11-,12+,13-,14-,15-,18+,19+/m0/s1

Standard InChI Key:  GYXDEGFLWPXLBO-DXXLCSEDSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   24.2996   -4.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2996   -3.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5824   -4.4827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5820   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7927   -3.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3589   -2.8581    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.5737   -2.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2965   -2.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2960   -5.7204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8003   -4.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3059   -4.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4865   -4.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1548   -4.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6450   -5.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4710   -5.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9638   -6.1702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2084   -5.4583    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.0083   -3.6575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0053   -4.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7881   -4.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7929   -3.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2716   -4.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0812   -3.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4186   -3.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9442   -2.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1281   -2.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3746   -2.6861    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.4792   -4.8695    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.6445   -1.9908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7184   -4.0614    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.5586   -4.6651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1625   -1.7578    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 19  1  0
 18  2  1  0
  3  4  1  0
  4  5  1  0
  5 11  1  0
 10  3  1  0
  4  6  1  6
  6  7  1  0
  2  8  2  0
  1  9  2  0
 10 11  1  0
 10 15  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  1
 10 17  1  1
 18 19  1  0
 19 20  1  0
 20 22  1  0
 21 18  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  1  1
 22 28  1  1
 26 29  1  1
 19 30  1  6
 25 30  1  0
 23 31  1  6
 25 32  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4764098

    ---

Associated Targets(non-human)

Human immunodeficiency virus (3636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.53Molecular Weight (Monoisotopic): 422.0970AlogP: -0.33#Rotatable Bonds: 1
Polar Surface Area: 101.31Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.70CX Basic pKa: CX LogP: -0.57CX LogD: -0.57
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: 2.82

References

1. Zhu M,Zhang X,Huang X,Wang H,Anjum K,Gu Q,Zhu T,Zhang G,Li D.  (2020)  Irregularly Bridged Epipolythiodioxopiperazines and Related Analogues: Sources, Structures, and Biological Activities.,  83  (6): [PMID:32543845] [10.1021/acs.jnatprod.9b01283]

Source