(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-3-(3-fluorophenyl)-1-(hydroxyamino)-1-oxopropan-2-yl)-4-phenylbutanamide

ID: ALA4764208

PubChem CID: 162661020

Max Phase: Preclinical

Molecular Formula: C31H35FN4O6

Molecular Weight: 578.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1cccc(F)c1)C(=O)NO

Standard InChI:  InChI=1S/C31H35FN4O6/c1-21(37)33-28(20-42-19-23-11-6-3-7-12-23)30(39)34-26(16-15-22-9-4-2-5-10-22)29(38)35-27(31(40)36-41)18-24-13-8-14-25(32)17-24/h2-14,17,26-28,41H,15-16,18-20H2,1H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t26-,27-,28+/m1/s1

Standard InChI Key:  GCXRXMZLLDEGQU-FCEKVYKBSA-N

Molfile:  

 
     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
    3.8583   -6.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5728   -5.6958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1439   -5.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8583   -6.9334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2873   -6.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0017   -5.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7162   -6.1084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0017   -4.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4308   -5.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1452   -6.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4308   -4.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1452   -6.9334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8597   -5.6958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5742   -6.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2886   -5.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5742   -6.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2886   -7.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0031   -6.1084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7176   -5.6958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2886   -4.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2848   -8.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9985   -8.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7138   -8.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7112   -7.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9971   -6.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2873   -6.9334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0017   -7.3459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0017   -8.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7162   -8.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7139   -9.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4275   -9.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1430   -9.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1404   -8.5801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4261   -8.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1452   -4.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1452   -3.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8616   -3.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8620   -2.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1470   -1.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4302   -2.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4333   -3.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9981   -9.4094    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 22 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764208

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 578.64Molecular Weight (Monoisotopic): 578.2541AlogP: 2.20#Rotatable Bonds: 15
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 2.58CX LogD: 2.56
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.30

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source