disodium mono(1-hydroxy-2-(1H-1,2,3-triazol-1-yl)ethane-1,1-diyldiphosphonate)

ID: ALA4764230

PubChem CID: 162661345

Max Phase: Preclinical

Molecular Formula: C4H7N3Na2O7P2

Molecular Weight: 273.08

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=P([O-])([O-])C(O)(Cn1ccnn1)P(=O)(O)O.[Na+].[Na+]

Standard InChI:  InChI=1S/C4H9N3O7P2.2Na/c8-4(15(9,10)11,16(12,13)14)3-7-2-1-5-6-7;;/h1-2,8H,3H2,(H2,9,10,11)(H2,12,13,14);;/q;2*+1/p-2

Standard InChI Key:  OICPOLIVDZIGII-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 18 16  0  0  0  0  0  0  0  0999 V2000
   22.6702  -12.2080    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
   27.0534  -12.4955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3408  -12.9121    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   27.0579  -13.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9159  -12.9080    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   24.1040  -12.6123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6367  -11.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6326  -12.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3533  -11.2658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8242  -11.7705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9118  -13.7329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3367  -13.7371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0409  -13.4579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1008  -11.6038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6560  -10.9935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2471  -10.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4393  -10.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1659  -12.4246    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  6  5  1  0
  7  8  1  0
  7  9  1  0
  8  5  1  0
  8  3  1  0
  8 10  1  0
  5 11  2  0
  3 12  2  0
  5 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  9  1  0
M  CHG  4   1   1   2  -1   4  -1  18   1
M  END

Associated Targets(Human)

GGPS1 Tchem Geranylgeranyl pyrophosphate synthetase (715 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 273.08Molecular Weight (Monoisotopic): 272.9916AlogP: -1.72#Rotatable Bonds: 4
Polar Surface Area: 166.00Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 0.40CX Basic pKa: 0.93CX LogP: -3.47CX LogD: -7.73
Aromatic Rings: 1Heavy Atoms: 16QED Weighted: 0.40Np Likeness Score: -0.82

References

1. Legigan T,Migianu-Griffoni E,Redouane MA,Descamps A,Deschamp J,Gager O,Monteil M,Barbault F,Lecouvey M.  (2021)  Synthesis and preliminary anticancer evaluation of new triazole bisphosphonate-based isoprenoid biosynthesis inhibitors.,  214  [PMID:33571830] [10.1016/j.ejmech.2021.113241]

Source