Methyl 2-(7-((3-(4-chlorophenyl)propyl)carbamoyl)-6-(3-fluorophenyl)-4-oxoquinazolin-3(4H)-yl)acetate

ID: ALA4764235

PubChem CID: 156788076

Max Phase: Preclinical

Molecular Formula: C27H23ClFN3O4

Molecular Weight: 507.95

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)Cn1cnc2cc(C(=O)NCCCc3ccc(Cl)cc3)c(-c3cccc(F)c3)cc2c1=O

Standard InChI:  InChI=1S/C27H23ClFN3O4/c1-36-25(33)15-32-16-31-24-14-22(26(34)30-11-3-4-17-7-9-19(28)10-8-17)21(13-23(24)27(32)35)18-5-2-6-20(29)12-18/h2,5-10,12-14,16H,3-4,11,15H2,1H3,(H,30,34)

Standard InChI Key:  XZZABADCCSPWDP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   20.3230   -3.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3218   -4.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0366   -4.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0348   -3.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7501   -3.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7535   -4.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4727   -4.9614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1931   -4.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1897   -3.7111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4659   -3.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4613   -2.4703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6084   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6116   -2.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8979   -2.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1826   -2.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1855   -3.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6070   -4.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8929   -4.5469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6064   -5.7849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8936   -3.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1781   -4.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4640   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4647   -3.7208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.7492   -4.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0351   -4.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0407   -3.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3275   -3.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6118   -3.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6138   -4.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3276   -4.9592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8986   -3.3106    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.9028   -3.2964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6186   -3.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3317   -3.2921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6211   -4.5317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0475   -3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 20  2  0
 20 12  1  0
 16 23  1  0
  2 17  1  0
 17 18  1  0
 17 19  2  0
 18 21  1  0
 21 22  1  0
 22 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
  9 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764235

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.95Molecular Weight (Monoisotopic): 507.1361AlogP: 4.39#Rotatable Bonds: 8
Polar Surface Area: 90.29Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.64CX LogP: 4.50CX LogD: 4.50
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -1.31

References

1. Ma Y,Yang J,Wei X,Pei Y,Ye J,Li X,Si G,Tian J,Dong Y,Liu G.  (2020)  Nonpeptidic quinazolinone derivatives as dual nucleotide-binding oligomerization domain-like receptor 1/2 antagonists for adjuvant cancer chemotherapy.,  207  [PMID:32920426] [10.1016/j.ejmech.2020.112723]

Source