The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2,4-difluorophenyl)-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine-6-carboxamide ID: ALA4764246
PubChem CID: 46344609
Max Phase: Preclinical
Molecular Formula: C19H19F2N5OS
Molecular Weight: 403.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)Nc2ccc(F)cc2F)sc2ncnc(N3CCN(C)CC3)c12
Standard InChI: InChI=1S/C19H19F2N5OS/c1-11-15-17(26-7-5-25(2)6-8-26)22-10-23-19(15)28-16(11)18(27)24-14-4-3-12(20)9-13(14)21/h3-4,9-10H,5-8H2,1-2H3,(H,24,27)
Standard InChI Key: QZLJXIWBMJKIRP-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
10.2737 -11.2774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9907 -10.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9877 -10.0326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2718 -9.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5584 -10.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5551 -10.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7695 -9.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2873 -10.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7748 -11.1222 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.2675 -8.8031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9830 -8.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9823 -7.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2678 -7.1529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5523 -7.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5513 -8.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2683 -6.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5112 -9.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4617 -10.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0459 -9.7470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0518 -11.1769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2203 -9.7503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8068 -9.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9820 -9.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5713 -9.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9915 -10.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8149 -10.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7457 -9.7613 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.2177 -8.3205 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
4 10 1 0
13 16 1 0
7 17 1 0
8 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
22 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.46Molecular Weight (Monoisotopic): 403.1278AlogP: 3.28#Rotatable Bonds: 3Polar Surface Area: 61.36Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.81CX Basic pKa: 7.49CX LogP: 3.87CX LogD: 3.52Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: -2.56