5-(2,5-dihydro-1H-pyrrole-1-carbonyl)-2-hydroxy-3-propylbenzonitrile

ID: ALA4764339

PubChem CID: 162661106

Max Phase: Preclinical

Molecular Formula: C15H16N2O2

Molecular Weight: 256.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCc1cc(C(=O)N2CC=CC2)cc(C#N)c1O

Standard InChI:  InChI=1S/C15H16N2O2/c1-2-5-11-8-12(9-13(10-16)14(11)18)15(19)17-6-3-4-7-17/h3-4,8-9,18H,2,5-7H2,1H3

Standard InChI Key:  HLJFFBFHGZWKTG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   36.1407  -15.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1396  -16.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8476  -16.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5573  -16.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5545  -15.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8458  -15.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4329  -15.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4327  -14.2845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7253  -15.5104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9774  -15.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4307  -15.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8395  -16.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6388  -16.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2656  -16.7366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8504  -17.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8502  -18.3735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2606  -15.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9699  -15.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6760  -15.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
  4 14  1  0
 15 16  3  0
  3 15  1  0
  5 17  1  0
 17 18  1  0
 18 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764339

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 256.30Molecular Weight (Monoisotopic): 256.1212AlogP: 2.23#Rotatable Bonds: 3
Polar Surface Area: 64.33Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.39CX Basic pKa: CX LogP: 2.58CX LogD: 2.28
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.84Np Likeness Score: -0.67

References

1. Uda J,Kobashi S,Ashizawa N,Matsumoto K,Iwanaga T.  (2021)  Novel monocyclic amide-linked phenol derivatives without mitochondrial toxicity have potent uric acid-lowering activity.,  40  [PMID:33684442] [10.1016/j.bmcl.2021.127900]

Source