The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-6-(2-chloro-4-(3-methyl-2-oxopyridin-1(2H)-yl)phenyl)-1H-indazole-3-carbox-amide ID: ALA4764341
PubChem CID: 162661107
Max Phase: Preclinical
Molecular Formula: C27H21ClN4O2
Molecular Weight: 468.94
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccn(-c2ccc(-c3ccc4c(C(=O)NCc5ccccc5)n[nH]c4c3)c(Cl)c2)c1=O
Standard InChI: InChI=1S/C27H21ClN4O2/c1-17-6-5-13-32(27(17)34)20-10-12-21(23(28)15-20)19-9-11-22-24(14-19)30-31-25(22)26(33)29-16-18-7-3-2-4-8-18/h2-15H,16H2,1H3,(H,29,33)(H,30,31)
Standard InChI Key: CTTCTIKLVJICRD-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
22.7283 -11.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1584 -12.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1555 -11.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4401 -11.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8685 -11.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5817 -11.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2942 -11.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2916 -10.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5704 -10.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8610 -10.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0039 -10.1877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7169 -10.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4289 -10.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4250 -9.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7035 -8.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9945 -9.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6963 -8.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2758 -8.9593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1428 -10.2038 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.4419 -13.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7275 -12.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1168 -13.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4540 -13.9852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2729 -13.8967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3093 -13.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0522 -12.2804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7590 -13.6790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9515 -13.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4012 -14.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5970 -13.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0475 -14.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3008 -15.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1088 -15.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6636 -14.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 21 2 0
20 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
3 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 1 0
15 17 1 0
16 18 2 0
10 19 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 1 0
22 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 34 2 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.94Molecular Weight (Monoisotopic): 468.1353AlogP: 5.27#Rotatable Bonds: 5Polar Surface Area: 79.78Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.80CX Basic pKa: ┄CX LogP: 5.05CX LogD: 5.05Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.63
References 1. Zhang M,Fang X,Wang C,Hua Y,Huang C,Wang M,Zhu L,Wang Z,Gao Y,Zhang T,Liu H,Zhang Y,Lu S,Lu T,Chen Y,Li H. (2020) Design and synthesis of 1H-indazole-3-carboxamide derivatives as potent and selective PAK1 inhibitors with anti-tumour migration and invasion activities., 203 [PMID:32846314 ] [10.1016/j.ejmech.2020.112517 ]