(4-(4-Chlorobenzoyl)piperidin-1-yl)(4-hydroxyphenyl)methanone

ID: ALA4764345

PubChem CID: 162661110

Max Phase: Preclinical

Molecular Formula: C19H18ClNO3

Molecular Weight: 343.81

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(Cl)cc1)C1CCN(C(=O)c2ccc(O)cc2)CC1

Standard InChI:  InChI=1S/C19H18ClNO3/c20-16-5-1-13(2-6-16)18(23)14-9-11-21(12-10-14)19(24)15-3-7-17(22)8-4-15/h1-8,14,22H,9-12H2

Standard InChI Key:  SZUDGFRKGKGVCX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    5.8572  -25.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8592  -24.1950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5612  -25.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2713  -25.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9793  -25.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9773  -26.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2672  -26.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5591  -26.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1471  -25.4232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1451  -26.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4391  -26.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7310  -26.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7331  -25.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4390  -25.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0209  -26.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0189  -27.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7270  -27.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7249  -28.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0190  -29.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3109  -28.6849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3129  -27.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3170  -26.2334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0169  -29.9125    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.6835  -26.6537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  3  8  2  0
  1  3  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  9 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 15 22  2  0
 19 23  1  0
 12 15  1  0
  1  9  1  0
  6 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764345

    ---

Associated Targets(Human)

MGLL Tchem Monoglyceride lipase (1909 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 343.81Molecular Weight (Monoisotopic): 343.0975AlogP: 3.78#Rotatable Bonds: 3
Polar Surface Area: 57.61Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.46CX Basic pKa: CX LogP: 3.40CX LogD: 3.36
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.86Np Likeness Score: -0.95

References

1. Granchi C,Rizzolio F,Palazzolo S,Carmignani S,Macchia M,Saccomanni G,Manera C,Martinelli A,Minutolo F,Tuccinardi T.  (2016)  Structural Optimization of 4-Chlorobenzoylpiperidine Derivatives for the Development of Potent, Reversible, and Selective Monoacylglycerol Lipase (MAGL) Inhibitors.,  59  (22): [PMID:27809504] [10.1021/acs.jmedchem.6b01459]

Source