(S)-3-(3-(4-guanidinobutyl)ureido)-2-((S)-1-(phenylsulfonyl)pyrrolidine-2-carboxamido)propanoic acid

ID: ALA4764427

PubChem CID: 131965316

Max Phase: Preclinical

Molecular Formula: C20H31N7O6S

Molecular Weight: 497.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCCCNC(=O)NC[C@H](NC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccccc1)C(=O)O

Standard InChI:  InChI=1S/C20H31N7O6S/c21-19(22)23-10-4-5-11-24-20(31)25-13-15(18(29)30)26-17(28)16-9-6-12-27(16)34(32,33)14-7-2-1-3-8-14/h1-3,7-8,15-16H,4-6,9-13H2,(H,26,28)(H,29,30)(H4,21,22,23)(H2,24,25,31)/t15-,16-/m0/s1

Standard InChI Key:  IUFCIFVCEOUHLU-HOTGVXAUSA-N

Molfile:  

 
     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   35.6056   -2.4103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3910   -3.2027    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.1866   -2.9888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5880   -4.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3024   -3.9187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.0199   -4.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7302   -3.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4477   -4.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1621   -3.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5890   -5.1554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8756   -3.9222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1643   -4.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4520   -3.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7406   -4.3376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4509   -3.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1623   -2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7386   -2.6949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0283   -3.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3211   -4.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0273   -3.1044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5708   -4.0060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0206   -4.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4301   -5.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2333   -5.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6130   -2.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4478   -2.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6706   -1.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0658   -2.4507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2393   -3.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0162   -3.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8744   -4.3199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.5858   -3.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2981   -4.3181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.5847   -3.0850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  2  0
  4 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  6
 15 16  2  0
 15 17  1  0
 14 18  1  0
 19 18  1  6
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
 21  2  1  0
  2 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  9 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4764427

    ---

Associated Targets(Human)

ITGB1 Tclin Integrin alpha-5/beta-1 (686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB1 Tclin Integrin alpha-V/beta-1 (222 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 497.58Molecular Weight (Monoisotopic): 497.2057AlogP: -1.03#Rotatable Bonds: 12
Polar Surface Area: 206.81Molecular Species: ZWITTERIONHBA: 6HBD: 7
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.27CX Basic pKa: 12.04CX LogP: -3.06CX LogD: -3.06
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.11Np Likeness Score: -1.03

References

1. Sundaram A,Chen C,Isik Reed N,Liu S,Ki Yeon S,McIntosh J,Tang YZ,Yang H,Adler M,Beresis R,Seiple IB,Sheppard D,DeGrado WF,Jo H.  (2020)  Dual antagonists of α5β1/αvβ1 integrin for airway hyperresponsiveness.,  30  (22): [PMID:33007395] [10.1016/j.bmcl.2020.127578]

Source