(4S,7R)-7-((S)-1-Acetylpyrrolidine-2-carboxamido)-N,N-diethyl-6,10-dioxo-1,3,4,5,6,7,8,10-octahydrobenzo[j][1]oxa[8]thia[5]-azacyclododecine-4-carboxamide

ID: ALA4764486

PubChem CID: 162661355

Max Phase: Preclinical

Molecular Formula: C25H34N4O6S

Molecular Weight: 518.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)C(=O)[C@H]1CSCc2ccccc2C(=O)OC[C@@H](NC(=O)[C@@H]2CCCN2C(C)=O)C(=O)N1

Standard InChI:  InChI=1S/C25H34N4O6S/c1-4-28(5-2)24(33)20-15-36-14-17-9-6-7-10-18(17)25(34)35-13-19(22(31)27-20)26-23(32)21-11-8-12-29(21)16(3)30/h6-7,9-10,19-21H,4-5,8,11-15H2,1-3H3,(H,26,32)(H,27,31)/t19-,20-,21+/m1/s1

Standard InChI Key:  PEVNHUFJYQZBLV-NJYVYQBISA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   11.3344  -20.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3333  -21.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0480  -21.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7645  -21.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7616  -20.5126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0462  -20.1034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4796  -21.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4809  -22.5794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1934  -21.3408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9085  -21.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6223  -21.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3374  -21.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6210  -20.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3349  -20.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9018  -20.1094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4745  -20.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4714  -19.2724    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.1895  -18.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9005  -19.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6153  -18.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3294  -19.2857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3387  -22.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6250  -22.9886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0539  -22.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1450  -23.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9522  -23.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3637  -23.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8106  -22.6477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9807  -21.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7648  -21.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3666  -21.2896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6161  -18.0476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3309  -17.6357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9019  -17.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0450  -18.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1872  -18.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  6
 11 13  1  0
 13 14  2  0
 13 15  1  0
 15 19  1  0
  5 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  6
 20 21  2  0
 12 22  1  0
 22 23  2  0
 24 22  1  1
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 20 32  1  0
 32 33  1  0
 32 34  1  0
 33 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764486

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.64Molecular Weight (Monoisotopic): 518.2199AlogP: 0.94#Rotatable Bonds: 5
Polar Surface Area: 125.12Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.85CX Basic pKa: CX LogP: 0.13CX LogD: 0.13
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.56Np Likeness Score: -0.42

References

1. Begnini F,Poongavanam V,Over B,Castaldo M,Geschwindner S,Johansson P,Tyagi M,Tyrchan C,Wissler L,Sjö P,Schiesser S,Kihlberg J.  (2021)  Mining Natural Products for Macrocycles to Drug Difficult Targets.,  64  (2.0): [PMID:33337880] [10.1021/acs.jmedchem.0c01569]

Source