2-((4-(N-(carboxymethyl)-2,4,6-trimethylphenylsulfonamido)naphthalen-1-yl)oxy)-2-(4-ethoxyphenyl)acetic acid

ID: ALA4764502

PubChem CID: 154584182

Max Phase: Preclinical

Molecular Formula: C31H31NO8S

Molecular Weight: 577.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1ccc(C(Oc2ccc(N(CC(=O)O)S(=O)(=O)c3c(C)cc(C)cc3C)c3ccccc23)C(=O)O)cc1

Standard InChI:  InChI=1S/C31H31NO8S/c1-5-39-23-12-10-22(11-13-23)29(31(35)36)40-27-15-14-26(24-8-6-7-9-25(24)27)32(18-28(33)34)41(37,38)30-20(3)16-19(2)17-21(30)4/h6-17,29H,5,18H2,1-4H3,(H,33,34)(H,35,36)

Standard InChI Key:  BYDRCKDNJKPUKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   13.7891   -5.2829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2018   -4.5771    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.3842   -4.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8012   -6.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8001   -7.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5081   -7.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5064   -5.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2150   -6.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2157   -7.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9243   -7.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6325   -7.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6278   -6.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9187   -5.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9144   -4.9846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6199   -4.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3298   -4.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0353   -4.5647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3341   -5.7942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9260   -8.2552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6345   -8.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6362   -9.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3414   -8.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9294   -9.8896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3448   -9.8867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0469   -8.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7533   -8.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7521   -7.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0385   -7.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3351   -7.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2002   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9060   -3.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9048   -2.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1980   -2.1387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4910   -2.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4958   -3.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6132   -3.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7911   -3.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1952   -1.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4584   -7.0244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1675   -7.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8738   -7.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 22 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 22  1  0
 14  2  1  0
  2 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 31 36  1  0
 35 37  1  0
 33 38  1  0
 27 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764502

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 577.66Molecular Weight (Monoisotopic): 577.1770AlogP: 5.65#Rotatable Bonds: 11
Polar Surface Area: 130.44Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.10CX Basic pKa: CX LogP: 6.15CX LogD: -0.64
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -0.96

References

1. Lu MC,Shao HL,Liu T,You QD,Jiang ZY.  (2020)  Discovery of 2-oxy-2-phenylacetic acid substituted naphthalene sulfonamide derivatives as potent KEAP1-NRF2 protein-protein interaction inhibitors for inflammatory conditions.,  207  [PMID:32866756] [10.1016/j.ejmech.2020.112734]

Source