The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(N-(carboxymethyl)-2,4,6-trimethylphenylsulfonamido)naphthalen-1-yl)oxy)-2-(4-ethoxyphenyl)acetic acid ID: ALA4764502
PubChem CID: 154584182
Max Phase: Preclinical
Molecular Formula: C31H31NO8S
Molecular Weight: 577.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(C(Oc2ccc(N(CC(=O)O)S(=O)(=O)c3c(C)cc(C)cc3C)c3ccccc23)C(=O)O)cc1
Standard InChI: InChI=1S/C31H31NO8S/c1-5-39-23-12-10-22(11-13-23)29(31(35)36)40-27-15-14-26(24-8-6-7-9-25(24)27)32(18-28(33)34)41(37,38)30-20(3)16-19(2)17-21(30)4/h6-17,29H,5,18H2,1-4H3,(H,33,34)(H,35,36)
Standard InChI Key: BYDRCKDNJKPUKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
13.7891 -5.2829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2018 -4.5771 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3842 -4.5725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8012 -6.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8001 -7.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5081 -7.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5064 -5.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2150 -6.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2157 -7.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9243 -7.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6325 -7.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6278 -6.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9187 -5.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9144 -4.9846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6199 -4.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3298 -4.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0353 -4.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3341 -5.7942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9260 -8.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6345 -8.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6362 -9.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3414 -8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9294 -9.8896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3448 -9.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0469 -8.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7533 -8.2534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7521 -7.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0385 -7.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3351 -7.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2002 -3.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9060 -3.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9048 -2.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1980 -2.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4910 -2.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4958 -3.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6132 -3.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7911 -3.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1952 -1.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4584 -7.0244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1675 -7.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8738 -7.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
10 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
21 23 2 0
21 24 1 0
22 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 22 1 0
14 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
31 36 1 0
35 37 1 0
33 38 1 0
27 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.66Molecular Weight (Monoisotopic): 577.1770AlogP: 5.65#Rotatable Bonds: 11Polar Surface Area: 130.44Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.10CX Basic pKa: ┄CX LogP: 6.15CX LogD: -0.64Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -0.96
References 1. Lu MC,Shao HL,Liu T,You QD,Jiang ZY. (2020) Discovery of 2-oxy-2-phenylacetic acid substituted naphthalene sulfonamide derivatives as potent KEAP1-NRF2 protein-protein interaction inhibitors for inflammatory conditions., 207 [PMID:32866756 ] [10.1016/j.ejmech.2020.112734 ]