(S)-1-[1-Carboxy-2-(4-hydroxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenylthiomethyl]-1H-1,2,3-triazole

ID: ALA4764523

PubChem CID: 162661687

Max Phase: Preclinical

Molecular Formula: C19H16F3N3O3S

Molecular Weight: 423.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)[C@H](Cc1ccc(O)cc1)n1cc(CSc2cccc(C(F)(F)F)c2)nn1

Standard InChI:  InChI=1S/C19H16F3N3O3S/c20-19(21,22)13-2-1-3-16(9-13)29-11-14-10-25(24-23-14)17(18(27)28)8-12-4-6-15(26)7-5-12/h1-7,9-10,17,26H,8,11H2,(H,27,28)/t17-/m0/s1

Standard InChI Key:  QYHMDAOXTKTBGO-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   11.4105  -23.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8255  -22.4475    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0006  -22.4390    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.7373  -23.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6980  -23.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3410  -23.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0287  -23.2594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8076  -22.4644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9834  -22.4292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4526  -23.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1662  -23.6736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4543  -22.4346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9790  -23.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2686  -23.1885    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.5501  -23.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8426  -23.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1247  -23.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1161  -24.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8315  -24.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5465  -24.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7355  -24.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0202  -24.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3091  -24.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5942  -24.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5920  -25.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3107  -26.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0225  -25.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6958  -23.5627    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.8748  -26.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7  4  1  0
  4 10  1  0
 10 11  1  0
 10 12  2  0
  5 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  4 21  1  6
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 17  1  1  0
  1 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764523

    ---

Associated Targets(Human)

FKBP1A Tclin FK506-binding protein 1A (1014 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RYR1 Tclin RyR1/FKBP12 (34 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.42Molecular Weight (Monoisotopic): 423.0864AlogP: 4.16#Rotatable Bonds: 7
Polar Surface Area: 88.24Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.31CX Basic pKa: 0.18CX LogP: 4.42CX LogD: 0.99
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -1.18

References

1. Aizpurua JM,Miranda JI,Irastorza A,Torres E,Eceiza M,Sagartzazu-Aizpurua M,Ferrón P,Aldanondo G,Lasa-Fernández H,Marco-Moreno P,Dadie N,López de Munain A,Vallejo-Illarramendi A.  (2021)  Discovery of a novel family of FKBP12 "reshapers" and their use as calcium modulators in skeletal muscle under nitro-oxidative stress.,  213  [PMID:33493827] [10.1016/j.ejmech.2021.113160]

Source