(2R)-2-([(5Sa)-5-(3-Chloro-2-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl)-6-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-yl]oxy)-3-phenylpropanoic acid

ID: ALA4764571

PubChem CID: 162660814

Max Phase: Preclinical

Molecular Formula: C33H34ClN5O4S2

Molecular Weight: 664.25

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2sc3ncnc(O[C@H](Cc4ccccc4)C(=O)O)c3c2-c2ccc(OCCN3CCN(C)CC3)c(Cl)c2C)cs1

Standard InChI:  InChI=1S/C33H34ClN5O4S2/c1-20-23(9-10-25(29(20)34)42-16-15-39-13-11-38(3)12-14-39)27-28-31(43-26(33(40)41)17-22-7-5-4-6-8-22)35-19-36-32(28)45-30(27)24-18-44-21(2)37-24/h4-10,18-19,26H,11-17H2,1-3H3,(H,40,41)/t26-/m1/s1

Standard InChI Key:  IGZFDVQGVPGLFW-AREMUKBSSA-N

Molfile:  

 
     RDKit          2D

 45 50  0  0  0  0  0  0  0  0999 V2000
   12.7187  -24.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7176  -25.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4256  -25.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1353  -25.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1324  -24.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4238  -23.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8436  -25.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8449  -26.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5532  -26.6780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1378  -26.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4295  -26.2728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1391  -27.4974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5545  -27.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8489  -27.9021    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8498  -28.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5587  -29.1268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2637  -27.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2721  -28.7097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0470  -28.9527    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.5176  -28.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0334  -27.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2754  -26.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0743  -26.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3189  -25.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7655  -25.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9644  -25.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7236  -26.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6267  -27.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1165  -25.7285    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.0090  -24.5237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8063  -24.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3601  -24.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1574  -24.7661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7115  -25.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5057  -25.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7533  -24.4144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2002  -23.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3996  -23.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5513  -24.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3358  -28.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8230  -28.9353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5976  -28.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5891  -27.8575    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.8093  -27.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2636  -29.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  8  7  1  1
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 18  1  0
 17 13  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 22 27  1  0
 21 22  1  0
 23 28  1  0
 24 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 36 39  1  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  1  0
 44 40  2  0
 20 40  1  0
 42 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764571

    ---

Associated Targets(Human)

NCI-H929 (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 664.25Molecular Weight (Monoisotopic): 663.1741AlogP: 6.45#Rotatable Bonds: 11
Polar Surface Area: 100.91Molecular Species: ACIDHBA: 10HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.15CX Basic pKa: 7.65CX LogP: 4.00CX LogD: 3.86
Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.17Np Likeness Score: -0.92

References

1. Szlavik Z,Csekei M,Paczal A,Szabo ZB,Sipos S,Radics G,Proszenyak A,Balint B,Murray J,Davidson J,Chen I,Dokurno P,Surgenor AE,Daniels ZM,Hubbard RE,Le Toumelin-Braizat G,Claperon A,Lysiak-Auvity G,Girard AM,Bruno A,Chanrion M,Colland F,Maragno AL,Demarles D,Geneste O,Kotschy A.  (2020)  Discovery of S64315, a Potent and Selective Mcl-1 Inhibitor.,  63  (22): [PMID:33146521] [10.1021/acs.jmedchem.0c01234]

Source