The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
20-O-(4-(3-(2-naphthoyl)thioureido)butanoate)camptothecin ID: ALA4764591
PubChem CID: 162660941
Max Phase: Preclinical
Molecular Formula: C36H30N4O6S
Molecular Weight: 646.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(OC(=O)CCCNC(=S)NC(=O)c2ccc3ccccc3c2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1
Standard InChI: InChI=1S/C36H30N4O6S/c1-2-36(46-30(41)12-7-15-37-35(47)39-32(42)24-14-13-21-8-3-4-9-22(21)16-24)27-18-29-31-25(17-23-10-5-6-11-28(23)38-31)19-40(29)33(43)26(27)20-45-34(36)44/h3-6,8-11,13-14,16-18H,2,7,12,15,19-20H2,1H3,(H2,37,39,42,47)/t36-/m0/s1
Standard InChI Key: LPGZEWWWAQQOKA-BHVANESWSA-N
Molfile:
RDKit 2D
47 53 0 0 0 0 0 0 0 0999 V2000
42.1060 -14.5815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.3206 -13.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5265 -13.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1820 -12.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1496 -11.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6352 -10.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4798 -12.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9965 -13.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1381 -13.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6255 -13.2215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2938 -12.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8545 -12.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3346 -11.5454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8514 -10.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0745 -11.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0763 -11.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3694 -10.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3698 -12.3658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6623 -11.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6631 -11.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9539 -10.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2434 -11.1408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2466 -11.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9564 -12.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9517 -13.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4642 -14.6332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3161 -14.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1024 -15.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7398 -14.2115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.6787 -16.1590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4651 -16.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0414 -17.5272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8313 -17.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4076 -17.8972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0449 -16.5291 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
44.1975 -17.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7738 -18.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4111 -16.8991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.5557 -19.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1312 -19.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5572 -18.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1343 -18.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9213 -19.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5007 -20.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.2932 -19.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.5031 -18.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.9222 -18.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
12 4 2 0
4 8 1 0
7 5 1 0
5 13 1 0
5 6 2 0
7 8 2 0
7 11 1 0
8 2 1 0
2 9 1 0
9 10 1 0
10 11 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 12 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 2 0
18 15 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
3 25 1 0
9 26 2 0
1 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
36 37 1 0
36 38 2 0
37 39 2 0
39 40 1 0
40 43 2 0
42 41 2 0
41 37 1 0
42 43 1 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 646.73Molecular Weight (Monoisotopic): 646.1886AlogP: 4.87#Rotatable Bonds: 7Polar Surface Area: 128.62Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.62CX Basic pKa: 3.07CX LogP: 4.47CX LogD: 4.47Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.14Np Likeness Score: 0.06
References 1. Yang,CJ.; Li,B.; Zhang,ZJ.; Gao,JM.; Wang,MJ.; Zhao,XB.; Song,ZL.; Liu,YQ.; Li,H.; Chen,Y.; Lee,KH.; Morris-Natschke,SL.; Xu,C.. (2020) Design, synthesis and antineoplastic activity of novel 20(S)-acylthiourea derivatives of camptothecin., 187 [PMID:31881457 ] [10.1016/j.ejmech.2019.111971 ]