The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
20-O-((3-fluorobenzoyl)carbamothioyl)glycinate-camptothecin ID: ALA4764642
PubChem CID: 162661361
Max Phase: Preclinical
Molecular Formula: C30H23FN4O6S
Molecular Weight: 586.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(OC(=O)CNC(=S)NC(=O)c2cccc(F)c2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1
Standard InChI: InChI=1S/C30H23FN4O6S/c1-2-30(41-24(36)13-32-29(42)34-26(37)17-7-5-8-19(31)11-17)21-12-23-25-18(10-16-6-3-4-9-22(16)33-25)14-35(23)27(38)20(21)15-40-28(30)39/h3-12H,2,13-15H2,1H3,(H2,32,34,37,42)/t30-/m0/s1
Standard InChI Key: ZBKXNQSQYYUBDW-PMERELPUSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
18.6633 -15.7247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8779 -14.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0838 -15.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7393 -14.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7069 -12.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1926 -12.1182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0371 -13.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5538 -14.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6955 -15.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1829 -14.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8511 -13.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4118 -13.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8920 -12.6886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4088 -12.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6318 -13.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6336 -12.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9267 -11.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9271 -13.5091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2196 -13.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2204 -12.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5112 -11.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8008 -12.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8039 -13.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5137 -13.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5090 -14.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0216 -15.7765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8734 -15.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6598 -16.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2971 -15.3547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2361 -17.3023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0260 -17.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6023 -17.6723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2396 -16.3041 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.3922 -17.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9685 -18.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6058 -16.6741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7504 -18.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3259 -19.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1168 -19.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3290 -18.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7520 -17.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1181 -18.1929 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
12 4 2 0
4 8 1 0
7 5 1 0
5 13 1 0
5 6 2 0
7 8 2 0
7 11 1 0
8 2 1 0
2 9 1 0
9 10 1 0
10 11 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 12 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 2 0
18 15 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
3 25 1 0
9 26 2 0
1 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 2 0
35 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 35 1 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.60Molecular Weight (Monoisotopic): 586.1322AlogP: 3.07#Rotatable Bonds: 5Polar Surface Area: 128.62Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.38CX Basic pKa: 3.07CX LogP: 3.10CX LogD: 3.10Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -0.22
References 1. Yang,CJ.; Li,B.; Zhang,ZJ.; Gao,JM.; Wang,MJ.; Zhao,XB.; Song,ZL.; Liu,YQ.; Li,H.; Chen,Y.; Lee,KH.; Morris-Natschke,SL.; Xu,C.. (2020) Design, synthesis and antineoplastic activity of novel 20(S)-acylthiourea derivatives of camptothecin., 187 [PMID:31881457 ] [10.1016/j.ejmech.2019.111971 ]