1-(1-(bicyclo[1.1.1]pentan-1-yl)-1H-pyrazol-4-yl)-5-chloro-6-(1-(3-methyloxetan-3-yl)piperidin-4-yl)-1H-indazole

ID: ALA4764691

PubChem CID: 153575309

Max Phase: Preclinical

Molecular Formula: C24H28ClN5O

Molecular Weight: 437.98

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(N2CCC(c3cc4c(cnn4-c4cnn(C56CC(C5)C6)c4)cc3Cl)CC2)COC1

Standard InChI:  InChI=1S/C24H28ClN5O/c1-23(14-31-15-23)28-4-2-17(3-5-28)20-7-22-18(6-21(20)25)11-27-30(22)19-12-26-29(13-19)24-8-16(9-24)10-24/h6-7,11-13,16-17H,2-5,8-10,14-15H2,1H3

Standard InChI Key:  QTCZGGNAWDYGIG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 37  0  0  0  0  0  0  0  0999 V2000
    7.0768  -10.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0756  -11.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7837  -11.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7819  -10.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4905  -10.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4953  -11.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2753  -11.7571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7527  -11.0919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2676  -10.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5363  -12.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0598  -13.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5440  -13.8543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3198  -13.5972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3149  -12.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9817  -14.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3689  -11.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6616  -11.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9557  -11.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9509  -12.7336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6581  -13.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3702  -12.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2430  -13.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4546  -12.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2395  -13.7143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0279  -13.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3690  -10.2852    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.2387  -12.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1115  -14.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9135  -14.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7795  -13.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4118  -14.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 10  2  0
  7 10  1  0
 13 15  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  2 16  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 22  1  0
 19 22  1  0
  1 26  1  0
 22 27  1  0
 15 28  1  0
 28 29  1  0
 29 30  1  0
 30 15  1  0
 15 31  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764691

    ---

Associated Targets(Human)

LRRK2 Tchem Leucine-rich repeat serine/threonine-protein kinase 2 (6390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.98Molecular Weight (Monoisotopic): 437.1982AlogP: 4.35#Rotatable Bonds: 4
Polar Surface Area: 48.11Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.74CX LogP: 3.37CX LogD: 3.28
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.64

References

1. Sabnis RW..  (2021)  Novel N-Heteroaryl Indazole Derivatives as LRRK2 Inhibitors for Treating Parkinson's Disease.,  12  (4.0): [PMID:33859789] [10.1021/acsmedchemlett.1c00146]

Source