methyl 2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)acetate

ID: ALA4764712

PubChem CID: 146503703

Max Phase: Preclinical

Molecular Formula: C16H20N2O3

Molecular Weight: 288.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)CNC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C16H20N2O3/c1-21-14(19)9-17-16(20)18-15-12-6-2-4-10(12)8-11-5-3-7-13(11)15/h8H,2-7,9H2,1H3,(H2,17,18,20)

Standard InChI Key:  GPEUSHWTEKFXMA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   38.8570  -19.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2865  -20.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5703  -20.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8561  -20.1010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2458  -20.6537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5828  -21.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4014  -21.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0014  -20.5084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7148  -20.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4298  -20.5057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7132  -19.2700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5686  -18.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2830  -19.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8965  -18.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5613  -17.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7405  -18.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1431  -20.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8581  -20.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5714  -20.0893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8597  -21.3276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.2864  -20.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764712

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.35Molecular Weight (Monoisotopic): 288.1474AlogP: 1.96#Rotatable Bonds: 3
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.69CX Basic pKa: CX LogP: 2.74CX LogD: 2.74
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.84Np Likeness Score: -0.74

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source