N-(4-(3-(5-(((5-tert-butyloxazol-2-yl)methoxy)methyl)thiazol-2-ylamino)piperidine-1-carbonyl)phenyl)acrylamide

ID: ALA4764719

PubChem CID: 146646611

Max Phase: Preclinical

Molecular Formula: C27H33N5O4S

Molecular Weight: 523.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1ccc(C(=O)N2CCCC(Nc3ncc(COCc4ncc(C(C)(C)C)o4)s3)C2)cc1

Standard InChI:  InChI=1S/C27H33N5O4S/c1-5-23(33)30-19-10-8-18(9-11-19)25(34)32-12-6-7-20(15-32)31-26-29-13-21(37-26)16-35-17-24-28-14-22(36-24)27(2,3)4/h5,8-11,13-14,20H,1,6-7,12,15-17H2,2-4H3,(H,29,31)(H,30,33)

Standard InChI Key:  YPSQOIGPBAPUFM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    7.4229   -7.1887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1290   -6.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8745   -7.1053    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.4190   -6.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0077   -5.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2091   -5.9628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2298   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5636   -7.3219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3764   -7.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7136   -6.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7155   -5.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0103   -5.5606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3017   -5.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3029   -6.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0126   -7.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0107   -4.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7184   -4.3339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3030   -4.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3053   -3.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5984   -3.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8897   -3.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8923   -4.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5998   -4.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1815   -3.1084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1804   -2.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4722   -1.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8876   -1.8817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4711   -1.0664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7098   -8.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3036   -8.8603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8513   -9.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5974   -9.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5107   -8.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6824  -10.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9056  -10.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2905  -10.8124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4654  -11.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  2  0
  7  8  1  0
  4  7  1  0
  8  9  1  0
 10  1  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 17  2  0
 16 18  1  0
 12 16  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  2  0
  9 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 29  2  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764719

    ---

Associated Targets(Human)

CDK2 Tchem Cyclin-dependent kinase 2 (9050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK7 Tchem Cyclin-dependent kinase 7 (1512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.66Molecular Weight (Monoisotopic): 523.2253AlogP: 4.99#Rotatable Bonds: 9
Polar Surface Area: 109.59Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.94CX Basic pKa: 3.44CX LogP: 3.56CX LogD: 3.56
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -1.59

References

1.  (2020)  Inhibitors of cyclin-dependent kinases, 

Source