(R)-methyl 3-(4-cyanophenyl)-2-(3-(1,2,3,5,6,7-hexahydros-indacen-4-yl)ureido)propanoate

ID: ALA4764722

PubChem CID: 135331242

Max Phase: Preclinical

Molecular Formula: C24H25N3O3

Molecular Weight: 403.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@@H](Cc1ccc(C#N)cc1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2

Standard InChI:  InChI=1S/C24H25N3O3/c1-30-23(28)21(12-15-8-10-16(14-25)11-9-15)26-24(29)27-22-19-6-2-4-17(19)13-18-5-3-7-20(18)22/h8-11,13,21H,2-7,12H2,1H3,(H2,26,27,29)/t21-/m1/s1

Standard InChI Key:  WBOHILIPUWTKDD-OAQYLSRUSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    2.8485  -10.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2786  -11.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5621  -11.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8476  -11.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2370  -12.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5742  -12.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3931  -12.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9938  -11.8626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7075  -11.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4227  -11.8599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7058  -10.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5604  -10.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2751  -10.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8888  -10.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5534   -9.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7324   -9.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1363  -11.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8516  -11.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5652  -11.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8531  -12.6822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2805  -11.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1347  -10.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8485  -10.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5645  -10.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2778  -10.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2766   -9.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5563   -8.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8461   -9.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9871   -8.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7003   -8.5530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3  2  2  0
  2 13  1  0
 12  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 17 22  1  6
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  3  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764722

    ---

Associated Targets(Human)

NLRP3 Tchem NACHT, LRR and PYD domains-containing protein 3 (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.48Molecular Weight (Monoisotopic): 403.1896AlogP: 3.44#Rotatable Bonds: 5
Polar Surface Area: 91.22Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: CX LogP: 4.82CX LogD: 4.82
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.75Np Likeness Score: -0.72

References

1. Harrison D,Boutard N,Brzozka K,Bugaj M,Chmielewski S,Cierpich A,Doedens JR,Fabritius CRY,Gabel CA,Galezowski M,Kowalczyk P,Levenets O,Mroczkowska M,Palica K,Porter RA,Schultz D,Sowinska M,Topolnicki G,Urbanski P,Woyciechowski J,Watt AP.  (2020)  Discovery of a series of ester-substituted NLRP3 inflammasome inhibitors.,  30  (23): [PMID:32956781] [10.1016/j.bmcl.2020.127560]

Source