(O-(Hydroxy(((R)-1-methoxy-3-(oleoyloxy)-propan-2-yl)oxy)-phosphoryl)-L-serine

ID: ALA4764776

PubChem CID: 90322737

Max Phase: Preclinical

Molecular Formula: C25H48NO9P

Molecular Weight: 537.63

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](COC)OP(=O)(O)OC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C25H48NO9P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)33-20-22(19-32-2)35-36(30,31)34-21-23(26)25(28)29/h10-11,22-23H,3-9,12-21,26H2,1-2H3,(H,28,29)(H,30,31)/b11-10-/t22-,23+/m1/s1

Standard InChI Key:  AWVXRDOQCOHYDO-MCNIBRDVSA-N

Molfile:  

 
     RDKit          2D

 36 35  0  0  0  0  0  0  0  0999 V2000
    6.5257  -16.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5248  -17.0391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2203  -15.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9369  -16.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6335  -15.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3501  -16.1630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0467  -15.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7634  -16.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4599  -15.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1766  -16.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8146  -15.8197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1971  -16.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4999  -17.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7821  -16.9524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0849  -17.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3672  -16.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6700  -17.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9522  -17.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2550  -17.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2755  -18.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2770  -13.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6897  -14.5898    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    4.0982  -13.8774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5683  -15.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2761  -14.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8606  -14.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1529  -15.0025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8606  -13.7767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5683  -15.8197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9838  -15.0025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3992  -15.0025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1069  -14.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8146  -15.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1069  -13.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8146  -13.3681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8146  -12.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 22 21  2  0
 23 22  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 26 28  2  0
 24 29  1  6
 25 30  1  0
 30 22  1  0
 22 31  1  0
 31 32  1  0
 32 33  1  0
 33 11  1  0
 32 34  1  6
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4764776

   (2S)-2-amino-3-[hydroxy-[(2R)-1-methoxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl]oxyphosphoryl]oxypropanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 537.63

Molecular Weight (Monoisotopic): 537.3067

AlogP: 5.13

#Rotatable Bonds: 25

Polar Surface Area: 154.61

Molecular Species: ZWITTERION

HBA: 8

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 10

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 1.43

CX Basic pKa: 9.38

CX LogP: 3.74

CX LogD: 0.76

Aromatic Rings: ┄

Heavy Atoms: 36

QED Weighted: 0.06

Np Likeness Score: 0.93

References

1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T.  (2020)  Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors.,  63  (17): [PMID:32787112] [10.1021/acs.jmedchem.0c01126]

Source

Source(1):

• Scientific Literature