The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(cyclopropylmethyl)-5-((3-fluoro-4-methoxybenzyl)amino)-2-(piperidin-1-yl)benzamide ID: ALA4764818
PubChem CID: 141764488
Max Phase: Preclinical
Molecular Formula: C24H30FN3O2
Molecular Weight: 411.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNc2ccc(N3CCCCC3)c(C(=O)NCC3CC3)c2)cc1F
Standard InChI: InChI=1S/C24H30FN3O2/c1-30-23-10-7-18(13-21(23)25)16-26-19-8-9-22(28-11-3-2-4-12-28)20(14-19)24(29)27-15-17-5-6-17/h7-10,13-14,17,26H,2-6,11-12,15-16H2,1H3,(H,27,29)
Standard InChI Key: BUMZYSZNRKVZQP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
35.1927 -5.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6386 -3.2312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5135 -4.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2232 -4.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2204 -3.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5118 -2.8351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8055 -4.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8067 -3.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0982 -4.4698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3914 -4.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1004 -2.8431 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.9265 -2.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3424 -2.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0518 -3.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7551 -2.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7478 -1.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0313 -1.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3309 -2.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4665 -3.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4739 -4.0261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1705 -2.7939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1853 -4.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7963 -5.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6134 -5.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4521 -1.5724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1635 -1.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8657 -1.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8616 -0.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1491 -0.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4407 -0.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 8 1 0
7 8 2 0
7 9 1 0
9 10 1 0
8 11 1 0
5 12 1 0
12 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 1 1 0
23 1 1 0
24 23 1 0
1 24 1 0
16 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.52Molecular Weight (Monoisotopic): 411.2322AlogP: 4.58#Rotatable Bonds: 8Polar Surface Area: 53.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.33CX LogP: 3.97CX LogD: 3.93Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -1.64
References 1. Tian W,Guo J,Zhang Q,Fang S,Zhou R,Hu J,Wang M,Zhang Y,Guo JM,Chen Z,Zhu J,Zheng C. (2021) The discovery of novel small molecule allosteric activators of aldehyde dehydrogenase 2., 212 [PMID:33383258 ] [10.1016/j.ejmech.2020.113119 ]