1-(4-(bis(4-chlorophenyl)methyl)piperazin-1-yl)-3-nitroprop-2-en-1-one

ID: ALA4764852

PubChem CID: 145865988

Max Phase: Preclinical

Molecular Formula: C20H19Cl2N3O3

Molecular Weight: 420.30

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/[N+](=O)[O-])N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C20H19Cl2N3O3/c21-17-5-1-15(2-6-17)20(16-3-7-18(22)8-4-16)24-13-11-23(12-14-24)19(26)9-10-25(27)28/h1-10,20H,11-14H2/b10-9+

Standard InChI Key:  BGRNCERJDJHCSW-MDZDMXLPSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   28.7678   -3.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3533   -3.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3533   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7697   -2.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3558   -1.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5299   -1.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1196   -2.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5318   -3.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5292   -4.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1188   -5.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5293   -6.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3586   -6.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7693   -5.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1185   -1.0356    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.1198   -6.7469    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   29.5929   -3.8930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0034   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0034   -3.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8284   -3.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2429   -3.8930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0679   -3.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8284   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4784   -3.1779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4784   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2992   -4.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7079   -5.3220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5314   -5.3272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2982   -6.0350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  2  1  0
  3  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  3  1  0
  6 14  1  0
 11 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 17 22  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
M  CHG  2  26   1  28  -1
M  END

Alternative Forms

  1. Parent:

    ALA4764852

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.30Molecular Weight (Monoisotopic): 419.0803AlogP: 4.02#Rotatable Bonds: 5
Polar Surface Area: 66.69Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.62CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.42Np Likeness Score: -0.94

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source