(R)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-N,2-dimethyl-3-oxohexanamide

ID: ALA4764893

PubChem CID: 162661496

Max Phase: Preclinical

Molecular Formula: C24H37N3O5

Molecular Weight: 447.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C

Standard InChI:  InChI=1S/C24H37N3O5/c1-8-9-20(28)16(4)23(30)26(5)19(14-17-10-12-18(32-7)13-11-17)24(31)27(6)21(15(2)3)22(25)29/h10-13,15-16,19,21H,8-9,14H2,1-7H3,(H2,25,29)/t16-,19-,21+/m1/s1

Standard InChI Key:  BNTAYFBIAPOLHC-BSIFCXSSSA-N

Molfile:  

 
     RDKit          2D

 32 32  0  0  0  0  0  0  0  0999 V2000
   13.6102  -20.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6090  -21.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3171  -21.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0267  -21.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0239  -20.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3153  -20.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9010  -21.9008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1936  -21.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7301  -20.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4393  -20.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1455  -20.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4424  -21.4815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7362  -21.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1516  -21.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1547  -22.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8578  -21.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4486  -23.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7393  -22.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8547  -20.6590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1424  -19.4359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8486  -19.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4332  -19.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5578  -19.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2640  -19.0193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5609  -20.2477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8455  -18.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5517  -17.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1362  -17.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8640  -23.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4516  -23.9331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0332  -23.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3239  -22.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  5  9  1  0
 10  9  1  6
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 11 19  2  0
 11 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  1
 26 27  1  0
 26 28  1  0
 15 29  1  6
 17 30  2  0
 18 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764893

    ---

Associated Targets(non-human)

MC3T3-E1 (421 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.2733AlogP: 2.04#Rotatable Bonds: 12
Polar Surface Area: 110.01Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.79CX Basic pKa: CX LogP: 2.64CX LogD: 2.64
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: 0.36

References

1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T.  (2020)  Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity.,  83  (8.0): [PMID:32786886] [10.1021/acs.jnatprod.0c00441]

Source