The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-fluoro-5-(trifluoromethyl)phenyl)-3-(4-(1-methyl-1H-imidazol-5-yl)-1H-1,2,3-triazol-1-yl)benzamide ID: ALA4764908
PubChem CID: 146293971
Max Phase: Preclinical
Molecular Formula: C20H14F4N6O
Molecular Weight: 430.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cncc1-c1cn(-c2cccc(C(=O)Nc3cc(F)cc(C(F)(F)F)c3)c2)nn1
Standard InChI: InChI=1S/C20H14F4N6O/c1-29-11-25-9-18(29)17-10-30(28-27-17)16-4-2-3-12(5-16)19(31)26-15-7-13(20(22,23)24)6-14(21)8-15/h2-11H,1H3,(H,26,31)
Standard InChI Key: JWENMWNPGXZIFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
27.4983 -17.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4972 -18.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2052 -19.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9149 -18.6280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9120 -17.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2034 -17.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6237 -19.0331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7105 -19.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5101 -20.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9176 -19.3059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3697 -18.6996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8444 -20.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4370 -21.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9847 -22.0745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7308 -21.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6440 -20.9284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2504 -20.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7891 -19.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0817 -18.6274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7885 -19.8537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0805 -20.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3748 -19.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6673 -20.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6662 -21.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3785 -21.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0832 -21.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3808 -22.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6742 -22.7120 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.7828 -23.0052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.1955 -22.2994 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.9601 -19.8477 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
4 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
9 12 1 0
16 17 1 0
2 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
25 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
23 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.37Molecular Weight (Monoisotopic): 430.1165AlogP: 4.08#Rotatable Bonds: 4Polar Surface Area: 77.63Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.29CX LogP: 3.85CX LogD: 3.85Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -2.14
References 1. (2020) Triazole benzamide derivatives as gpr142 agonists,