(1-(2-Aminobenzoyl)piperidin-4-yl)(4-chlorophenyl)methanone

ID: ALA4764949

PubChem CID: 119944555

Max Phase: Preclinical

Molecular Formula: C19H19ClN2O2

Molecular Weight: 342.83

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ccccc1C(=O)N1CCC(C(=O)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C19H19ClN2O2/c20-15-7-5-13(6-8-15)18(23)14-9-11-22(12-10-14)19(24)16-3-1-2-4-17(16)21/h1-8,14H,9-12,21H2

Standard InChI Key:  FKIYKZDLZFBXIR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   23.4310  -25.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4330  -24.2941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1349  -25.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8450  -25.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5531  -25.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5510  -26.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8409  -26.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1329  -26.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7208  -25.5222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7188  -26.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0128  -26.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3048  -26.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3068  -25.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0128  -25.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5947  -26.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5926  -27.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3007  -27.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2987  -28.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5927  -29.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8846  -28.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8867  -27.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8907  -26.3324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5907  -30.0115    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.8477  -24.2988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  3  8  2  0
  1  3  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  9 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 15 22  2  0
 19 23  1  0
 12 15  1  0
  1  9  1  0
  4 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764949

    ---

Associated Targets(Human)

MGLL Tchem Monoglyceride lipase (1909 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 342.83Molecular Weight (Monoisotopic): 342.1135AlogP: 3.66#Rotatable Bonds: 3
Polar Surface Area: 63.40Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.70CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.68Np Likeness Score: -1.20

References

1. Granchi C,Rizzolio F,Palazzolo S,Carmignani S,Macchia M,Saccomanni G,Manera C,Martinelli A,Minutolo F,Tuccinardi T.  (2016)  Structural Optimization of 4-Chlorobenzoylpiperidine Derivatives for the Development of Potent, Reversible, and Selective Monoacylglycerol Lipase (MAGL) Inhibitors.,  59  (22): [PMID:27809504] [10.1021/acs.jmedchem.6b01459]

Source