The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(6-(4-bromophenylthio)-2-cyano-1-oxo-1H-phenalen-3-ylamino)-N-(4-(dimethylamino)benzyl)propanamide ID: ALA4764983
PubChem CID: 162661143
Max Phase: Preclinical
Molecular Formula: C32H27BrN4O2S
Molecular Weight: 611.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(CNC(=O)CCNC2=C(C#N)C(=O)c3cccc4c(Sc5ccc(Br)cc5)ccc2c34)cc1
Standard InChI: InChI=1S/C32H27BrN4O2S/c1-37(2)22-10-6-20(7-11-22)19-36-29(38)16-17-35-31-25-14-15-28(40-23-12-8-21(33)9-13-23)24-4-3-5-26(30(24)25)32(39)27(31)18-34/h3-15,35H,16-17,19H2,1-2H3,(H,36,38)
Standard InChI Key: FHELUVXSXKRRCT-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
6.2261 -4.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2275 -5.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5212 -5.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9324 -3.9199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5142 -3.9254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5226 -6.3852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3940 -6.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1050 -6.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8163 -6.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8177 -7.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5307 -8.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5363 -8.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8261 -9.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1144 -8.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4080 -9.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6962 -8.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6907 -8.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4011 -7.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1130 -8.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6821 -6.3968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0995 -5.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0981 -4.7532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8317 -10.0762 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5436 -10.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2499 -10.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9618 -10.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9673 -11.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2610 -11.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5450 -11.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6791 -11.7038 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.5087 -3.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2191 -2.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2136 -1.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9240 -1.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6318 -1.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6373 -2.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9310 -3.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3370 -1.4512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0472 -1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3322 -0.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
1 5 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
7 18 1 0
18 19 1 0
10 19 2 0
14 19 1 0
7 20 2 0
21 22 3 0
8 21 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
27 30 1 0
23 24 1 0
13 23 1 0
6 9 1 0
3 6 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 2 0
5 31 1 0
35 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 611.57Molecular Weight (Monoisotopic): 610.1038AlogP: 6.55#Rotatable Bonds: 9Polar Surface Area: 85.23Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.85CX LogP: 5.68CX LogD: 5.68Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.23
References 1. Wang Z,Song T,Guo Z,Cao K,Chen C,Feng Y,Wang H,Yin F,Zhou S,Dai J,Zhang Z. (2020) Targeting the Allosteric Pathway That Interconnects the Core-Functional Scaffold and the Distal Phosphorylation Sites for Specific Dephosphorylation of Bcl-2., 63 (22): [PMID:33197310 ] [10.1021/acs.jmedchem.0c01290 ]