3-(6-(4-bromophenylthio)-2-cyano-1-oxo-1H-phenalen-3-ylamino)-N-(4-(dimethylamino)benzyl)propanamide

ID: ALA4764983

PubChem CID: 162661143

Max Phase: Preclinical

Molecular Formula: C32H27BrN4O2S

Molecular Weight: 611.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(CNC(=O)CCNC2=C(C#N)C(=O)c3cccc4c(Sc5ccc(Br)cc5)ccc2c34)cc1

Standard InChI:  InChI=1S/C32H27BrN4O2S/c1-37(2)22-10-6-20(7-11-22)19-36-29(38)16-17-35-31-25-14-15-28(40-23-12-8-21(33)9-13-23)24-4-3-5-26(30(24)25)32(39)27(31)18-34/h3-15,35H,16-17,19H2,1-2H3,(H,36,38)

Standard InChI Key:  FHELUVXSXKRRCT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    6.2261   -4.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2275   -5.1505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5212   -5.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9324   -3.9199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5142   -3.9254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5226   -6.3852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3940   -6.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1050   -6.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8163   -6.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8177   -7.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5307   -8.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5363   -8.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8261   -9.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1144   -8.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4080   -9.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6962   -8.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6907   -8.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4011   -7.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1130   -8.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6821   -6.3968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0995   -5.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0981   -4.7532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8317  -10.0762    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5436  -10.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2499  -10.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9618  -10.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9673  -11.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2610  -11.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5450  -11.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6791  -11.7038    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    5.5087   -3.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2191   -2.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2136   -1.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9240   -1.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6318   -1.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6373   -2.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9310   -3.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3370   -1.4512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0472   -1.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3322   -0.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  2  0
  1  5  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
  7 18  1  0
 18 19  1  0
 10 19  2  0
 14 19  1  0
  7 20  2  0
 21 22  3  0
  8 21  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 27 30  1  0
 23 24  1  0
 13 23  1  0
  6  9  1  0
  3  6  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 32 37  2  0
  5 31  1  0
 35 38  1  0
 38 39  1  0
 38 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4764983

    ---

Associated Targets(Human)

BCL2 Tclin Apoptosis regulator Bcl-2 (3787 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 611.57Molecular Weight (Monoisotopic): 610.1038AlogP: 6.55#Rotatable Bonds: 9
Polar Surface Area: 85.23Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.85CX LogP: 5.68CX LogD: 5.68
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.23

References

1. Wang Z,Song T,Guo Z,Cao K,Chen C,Feng Y,Wang H,Yin F,Zhou S,Dai J,Zhang Z.  (2020)  Targeting the Allosteric Pathway That Interconnects the Core-Functional Scaffold and the Distal Phosphorylation Sites for Specific Dephosphorylation of Bcl-2.,  63  (22): [PMID:33197310] [10.1021/acs.jmedchem.0c01290]

Source