The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Benzyl-5-nitro-6-(4-tosylpiperazin-1-yl)-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA4765013
PubChem CID: 162661299
Max Phase: Preclinical
Molecular Formula: C30H26N4O6S
Molecular Weight: 570.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N2CCN(c3c([N+](=O)[O-])cc4c5c(cccc35)C(=O)N(Cc3ccccc3)C4=O)CC2)cc1
Standard InChI: InChI=1S/C30H26N4O6S/c1-20-10-12-22(13-11-20)41(39,40)32-16-14-31(15-17-32)28-23-8-5-9-24-27(23)25(18-26(28)34(37)38)30(36)33(29(24)35)19-21-6-3-2-4-7-21/h2-13,18H,14-17,19H2,1H3
Standard InChI Key: QVGJPHRSCQTLIN-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
9.9714 -24.8005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7609 -25.5929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5524 -25.3790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1091 -27.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0639 -25.7216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6740 -26.4398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8807 -25.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4971 -25.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0744 -24.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2632 -24.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3034 -26.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9243 -27.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3565 -27.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1678 -27.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5449 -27.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1104 -26.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4643 -24.2453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0385 -23.5478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2813 -24.2253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3134 -25.6387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7359 -26.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5493 -26.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9466 -25.6094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5242 -24.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7045 -24.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6349 -25.0261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7259 -27.8532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1846 -26.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7873 -27.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2075 -27.7097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0255 -27.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4213 -26.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9988 -26.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4474 -28.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8572 -26.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4262 -25.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8137 -25.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3834 -24.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5657 -24.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1803 -25.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6129 -25.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 12 1 0
4 6 1 0
7 5 1 0
5 6 1 0
7 11 1 0
7 10 2 0
16 8 1 0
8 9 2 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
17 19 1 0
9 17 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
8 20 1 0
23 2 1 0
5 26 2 0
4 27 2 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
6 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M CHG 2 17 1 19 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.63Molecular Weight (Monoisotopic): 570.1573AlogP: 4.36#Rotatable Bonds: 6Polar Surface Area: 121.14Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.88CX LogD: 4.88Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.19Np Likeness Score: -1.44
References 1. Liang GB,Wei JH,Jiang H,Huang RZ,Qin JT,Wang HL,Wang HS,Zhang Y. (2021) Design, synthesis and antitumor evaluation of new 1,8-naphthalimide derivatives targeting nuclear DNA., 210 [PMID:33109400 ] [10.1016/j.ejmech.2020.112951 ]