N-[(3,4-dichlorophenyl)methyl]-2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]benzamide

ID: ALA4765043

PubChem CID: 146660774

Max Phase: Preclinical

Molecular Formula: C22H19Cl2N3O5S

Molecular Weight: 508.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)NCc1ccc(Cl)c(Cl)c1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C22H19Cl2N3O5S/c23-18-10-5-14(11-19(18)24)12-25-22(30)17-3-1-2-4-20(17)33(31,32)26-13-21(29)27-15-6-8-16(28)9-7-15/h1-11,26,28H,12-13H2,(H,25,30)(H,27,29)

Standard InChI Key:  GZMNVGLLXJLTLY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    7.9952  -21.7492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4662  -21.0720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6427  -21.0017    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5027  -21.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5015  -22.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2163  -22.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9327  -22.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9299  -21.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2145  -21.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2120  -20.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9252  -19.7681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4963  -19.7723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6397  -20.1767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3525  -19.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0686  -20.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0717  -20.9963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7814  -19.7561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4975  -20.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4960  -20.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2111  -21.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9251  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9192  -20.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2036  -19.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6416  -21.3915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4939  -18.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7782  -18.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7776  -17.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0628  -17.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3485  -17.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3537  -18.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0691  -18.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6420  -18.9657    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.6323  -17.3099    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 30 32  1  0
 29 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4765043

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.38Molecular Weight (Monoisotopic): 507.0422AlogP: 3.55#Rotatable Bonds: 8
Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 3.42CX LogD: 3.41
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -1.72

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source