Pseudobaptigenin-7-O-glucoside

ID: ALA4765046

Cas Number: 63347-43-3

PubChem CID: 3085261

Max Phase: Preclinical

Molecular Formula: C22H20O10

Molecular Weight: 444.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c(-c2ccc3c(c2)OCO3)coc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc12

Standard InChI:  InChI=1S/C22H20O10/c23-7-17-19(25)20(26)21(27)22(32-17)31-11-2-3-12-15(6-11)28-8-13(18(12)24)10-1-4-14-16(5-10)30-9-29-14/h1-6,8,17,19-23,25-27H,7,9H2/t17-,19-,20+,21-,22-/m1/s1

Standard InChI Key:  GWACEFYEIOPAJV-MIUGBVLSSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   33.6561  -11.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6550  -12.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3630  -12.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3612  -11.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0699  -11.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0706  -12.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7750  -12.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4874  -12.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4827  -11.4054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7694  -11.0020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9483  -11.0074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7767  -13.4555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1962  -12.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1940  -13.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9019  -13.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8962  -12.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6048  -12.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6110  -13.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3904  -13.6908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8660  -13.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3804  -12.3680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2407  -11.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5327  -11.0069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8272  -11.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8232  -12.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5308  -12.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2425  -12.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1209  -11.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1238  -10.1839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1140  -12.6358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5282  -13.4575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9498  -12.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  1  0
  1 11  1  0
  7 12  2  0
  8 13  1  0
 13 14  2  0
 14 15  1  0
 15 18  2  0
 17 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 22 11  1  1
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 24 28  1  1
 28 29  1  0
 25 30  1  6
 26 31  1  1
 27 32  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4765046

    Rothindin

Associated Targets(non-human)

C2C12 (756 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.39Molecular Weight (Monoisotopic): 444.1056AlogP: 0.37#Rotatable Bonds: 4
Polar Surface Area: 148.05Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: 0.39CX LogD: 0.39
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: 1.39

References

1. Zhang M,Zhang Y,Huang Q,Duan H,Zhao G,Liu L,Li Y.  (2021)  Flavonoids from Sophora alopecuroides L. improve palmitate-induced insulin resistance by inhibiting PTP1B activity in vitro.,  35  [PMID:33412152] [10.1016/j.bmcl.2021.127775]

Source