The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pseudobaptigenin-7-O-glucoside ID: ALA4765046
Cas Number: 63347-43-3
PubChem CID: 3085261
Max Phase: Preclinical
Molecular Formula: C22H20O10
Molecular Weight: 444.39
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c(-c2ccc3c(c2)OCO3)coc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc12
Standard InChI: InChI=1S/C22H20O10/c23-7-17-19(25)20(26)21(27)22(32-17)31-11-2-3-12-15(6-11)28-8-13(18(12)24)10-1-4-14-16(5-10)30-9-29-14/h1-6,8,17,19-23,25-27H,7,9H2/t17-,19-,20+,21-,22-/m1/s1
Standard InChI Key: GWACEFYEIOPAJV-MIUGBVLSSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
33.6561 -11.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6550 -12.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3630 -12.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3612 -11.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0699 -11.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0706 -12.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7750 -12.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4874 -12.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4827 -11.4054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7694 -11.0020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9483 -11.0074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7767 -13.4555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1962 -12.6343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1940 -13.4517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9019 -13.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8962 -12.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6048 -12.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6110 -13.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3904 -13.6908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8660 -13.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3804 -12.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2407 -11.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5327 -11.0069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8272 -11.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8232 -12.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5308 -12.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2425 -12.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1209 -11.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1238 -10.1839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1140 -12.6358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5282 -13.4575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9498 -12.6427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 1 0
1 11 1 0
7 12 2 0
8 13 1 0
13 14 2 0
14 15 1 0
15 18 2 0
17 16 2 0
16 13 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
22 11 1 1
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
24 28 1 1
28 29 1 0
25 30 1 6
26 31 1 1
27 32 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.39Molecular Weight (Monoisotopic): 444.1056AlogP: 0.37#Rotatable Bonds: 4Polar Surface Area: 148.05Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.20CX Basic pKa: ┄CX LogP: 0.39CX LogD: 0.39Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: 1.39
References 1. Zhang M,Zhang Y,Huang Q,Duan H,Zhao G,Liu L,Li Y. (2021) Flavonoids from Sophora alopecuroides L. improve palmitate-induced insulin resistance by inhibiting PTP1B activity in vitro., 35 [PMID:33412152 ] [10.1016/j.bmcl.2021.127775 ]