The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-((2-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-7-yl)ethyl)amino)-2-oxoethyl)-N-(4-(tert-butyl)phenyl)-1H-1,2,4-triazole-3-carboxamide ID: ALA4765125
PubChem CID: 162661057
Max Phase: Preclinical
Molecular Formula: C23H27N9O2
Molecular Weight: 461.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(NC(=O)c2ncn(CC(=O)NCCn3ccc4c(N)ncnc43)n2)cc1
Standard InChI: InChI=1S/C23H27N9O2/c1-23(2,3)15-4-6-16(7-5-15)29-22(34)20-28-14-32(30-20)12-18(33)25-9-11-31-10-8-17-19(24)26-13-27-21(17)31/h4-8,10,13-14H,9,11-12H2,1-3H3,(H,25,33)(H,29,34)(H2,24,26,27)
Standard InChI Key: XUVUBPKAABPFHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
28.6677 -16.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2497 -16.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4627 -16.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8989 -17.8381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8169 -16.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3730 -17.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6129 -16.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6570 -17.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3861 -17.9072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0715 -17.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0232 -16.6359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2938 -16.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2476 -15.4531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6488 -19.5984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2895 -19.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4923 -19.4005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8655 -18.8670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1678 -19.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3688 -20.1008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1881 -20.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4064 -18.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2935 -18.1830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5320 -17.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4220 -17.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6614 -16.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0118 -17.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1344 -18.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8927 -18.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7619 -19.4989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8558 -19.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6288 -20.5779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8770 -18.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6707 -18.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6105 -17.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 8 1 0
7 5 1 0
5 6 2 0
6 4 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
21 29 2 0
26 2 1 0
15 30 1 0
30 31 2 0
30 14 1 0
14 32 1 0
32 33 1 0
33 4 1 0
2 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.53Molecular Weight (Monoisotopic): 461.2288AlogP: 1.97#Rotatable Bonds: 7Polar Surface Area: 145.64Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.94CX Basic pKa: 6.72CX LogP: 2.29CX LogD: 2.21Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.75
References 1. Gibbons GS,Chakraborty A,Grigsby SM,Umeano AC,Liao C,Moukha-Chafiq O,Pathak V,Mathew B,Lee YT,Dou Y,Schürer SC,Reynolds RC,Snowden TS,Nikolovska-Coleska Z. (2020) Identification of DOT1L inhibitors by structure-based virtual screening adapted from a nucleoside-focused library., 189 [PMID:31978781 ] [10.1016/j.ejmech.2019.112023 ]