(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-(2,3,4-trifluorophenyl)propan-2-yl)-4-phenylbutanamide

ID: ALA4765190

PubChem CID: 162661716

Max Phase: Preclinical

Molecular Formula: C31H33F3N4O6

Molecular Weight: 614.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccc(F)c(F)c1F)C(=O)NO

Standard InChI:  InChI=1S/C31H33F3N4O6/c1-19(39)35-26(18-44-17-21-10-6-3-7-11-21)30(41)36-24(15-12-20-8-4-2-5-9-20)29(40)37-25(31(42)38-43)16-22-13-14-23(32)28(34)27(22)33/h2-11,13-14,24-26,43H,12,15-18H2,1H3,(H,35,39)(H,36,41)(H,37,40)(H,38,42)/t24-,25-,26+/m1/s1

Standard InChI Key:  FSGOFTQPNYNSIT-CYXNTTPDSA-N

Molfile:  

 
     RDKit          2D

 44 46  0  0  0  0  0  0  0  0999 V2000
    2.2625   -5.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9770   -5.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5481   -5.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2625   -6.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6915   -5.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4059   -5.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1204   -5.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4059   -4.6751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8349   -5.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5493   -5.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8349   -4.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5493   -6.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2638   -5.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9784   -5.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6928   -5.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9784   -6.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6928   -7.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4073   -5.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1218   -5.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6928   -4.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6889   -7.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4026   -8.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1180   -7.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1154   -7.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4011   -6.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6915   -6.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4059   -7.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4059   -7.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1204   -8.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1181   -9.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8317   -9.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5472   -9.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5445   -8.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8303   -7.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5493   -4.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5493   -3.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2658   -3.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2662   -2.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5511   -1.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8344   -2.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8375   -3.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9734   -8.3868    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.4022   -9.2136    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.8331   -8.3875    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 21 42  1  0
 22 43  1  0
 23 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4765190

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 614.62Molecular Weight (Monoisotopic): 614.2352AlogP: 2.48#Rotatable Bonds: 15
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 2.86CX LogD: 2.84
Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.10Np Likeness Score: -0.34

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source