The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,4R)-4-((S)-2,5-diaminopentanamido)-N-hydroxy-1-(4-methoxyphenylsulfonyl)pyrrolidine-2-carboxamide ID: ALA4765192
PubChem CID: 162661718
Max Phase: Preclinical
Molecular Formula: C17H27N5O6S
Molecular Weight: 429.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N2C[C@H](NC(=O)[C@@H](N)CCCN)C[C@@H]2C(=O)NO)cc1
Standard InChI: InChI=1S/C17H27N5O6S/c1-28-12-4-6-13(7-5-12)29(26,27)22-10-11(9-15(22)17(24)21-25)20-16(23)14(19)3-2-8-18/h4-7,11,14-15,25H,2-3,8-10,18-19H2,1H3,(H,20,23)(H,21,24)/t11-,14+,15-/m1/s1
Standard InChI Key: VNHNLDUXLRLXAA-BYCMXARLSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
8.9932 -26.3028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2875 -26.7197 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.9978 -27.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7983 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5101 -24.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0864 -24.5735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2219 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9296 -24.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6415 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3533 -24.5735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0651 -24.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1502 -25.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9536 -25.9692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3664 -25.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8154 -24.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9296 -23.7522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6415 -25.8076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1832 -25.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6636 -25.8370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4804 -25.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5155 -24.4211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8057 -27.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9903 -27.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5086 -27.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8466 -28.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6667 -28.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1406 -28.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3648 -29.3753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5476 -29.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 6 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 10 1 6
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
8 16 1 6
9 17 2 0
14 18 1 6
18 19 1 0
19 20 1 0
18 21 2 0
13 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.50Molecular Weight (Monoisotopic): 429.1682AlogP: -1.49#Rotatable Bonds: 9Polar Surface Area: 177.08Molecular Species: BASEHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.68CX Basic pKa: 9.93CX LogP: -3.33CX LogD: -5.35Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.23Np Likeness Score: -0.65
References 1. Lenci E,Contini A,Trabocchi A. (2020) Discovery of a d-pro-lys peptidomimetic inhibitor of MMP9: Addressing the gelatinase selectivity beyond S1' subsite., 30 (20.0): [PMID:32768649 ] [10.1016/j.bmcl.2020.127467 ]